C19H23N3O3 — CID 30307956
(3R)-3-N-[(6-methoxynaphthalen-2-yl)methyl]piperidine-1,3-dicarboxamide (PubChem CID 30307956) has the molecular formula C19H23N3O3 and a molecular weight of 341.41 g/mol. Its IUPAC name is (3R)-3-N-[(6-methoxynaphthalen-2-yl)methyl]piperidine-1,3-dicarboxamide.
| Compound Name | (3R)-3-N-[(6-methoxynaphthalen-2-yl)methyl]piperidine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 30307956 |
| Molecular Formula | C19H23N3O3 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.17 |
| IUPAC Name | (3R)-3-N-[(6-methoxynaphthalen-2-yl)methyl]piperidine-1,3-dicarboxamide |
| SMILES | COc1ccc2cc(CNC(=O)[C@@H]3CCCN(C(N)=O)C3)ccc2c1 |
| InChI | InChI=1S/C19H23N3O3/c1-25-17-7-6-14-9-13(4-5-15(14)10-17)11-21-18(23)16-3-2-8-22(12-16)19(20)24/h4-7,9-10,16H,2-3,8,11-12H2,1H3,(H2,20,24)(H,21,23)/t16-/m1/s1 |
| InChIKey | NGEAWKUDZZLGEE-MRXNPFEDSA-N |
| XLogP | 2.26 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |