About 3-[(5-chloro-2,3-dihydro-1H-inden-2-yl)amino]propanenitrile;hydrochloride
3-[(5-chloro-2,3-dihydro-1H-inden-2-yl)amino]propanenitrile;hydrochloride (PubChem CID 3030828) has the molecular formula C12H14Cl2N2
and a molecular weight of 257.16 g/mol. Its IUPAC name is 3-[(5-chloro-2,3-dihydro-1H-inden-2-yl)amino]propanenitrile;hydrochloride.
Molecular Properties
| Compound Name | 3-[(5-chloro-2,3-dihydro-1H-inden-2-yl)amino]propanenitrile;hydrochloride |
| PubChem CID | 3030828 |
| Molecular Formula | C12H14Cl2N2 |
| Molecular Weight | 257.16 g/mol |
| Exact Mass | 256.05 |
| IUPAC Name | 3-[(5-chloro-2,3-dihydro-1H-inden-2-yl)amino]propanenitrile;hydrochloride |
| SMILES | Cl.N#CCCNC1Cc2ccc(Cl)cc2C1 |
| InChI | InChI=1S/C12H13ClN2.ClH/c13-11-3-2-9-7-12(8-10(9)6-11)15-5-1-4-14;/h2-3,6,12,15H,1,5,7-8H2;1H |
| InChIKey | XMPVNVYMVZSWQI-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.16 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-[(5-chloro-2,3-dihydro-1H-inden-2-yl)amino]propanenitrile;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(5-chloro-2,3-dihydro-1H-inden-2-yl)amino]propanenitrile;hydrochloride?
The IUPAC name of 3-[(5-chloro-2,3-dihydro-1H-inden-2-yl)amino]propanenitrile;hydrochloride (CID 3030828) is 3-[(5-chloro-2,3-dihydro-1H-inden-2-yl)amino]propanenitrile;hydrochloride.
What is the SMILES notation for 3-[(5-chloro-2,3-dihydro-1H-inden-2-yl)amino]propanenitrile;hydrochloride?
The canonical SMILES for 3-[(5-chloro-2,3-dihydro-1H-inden-2-yl)amino]propanenitrile;hydrochloride is Cl.N#CCCNC1Cc2ccc(Cl)cc2C1.
What is the InChIKey of 3-[(5-chloro-2,3-dihydro-1H-inden-2-yl)amino]propanenitrile;hydrochloride?
The InChIKey is XMPVNVYMVZSWQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13ClN2.ClH/c13-11-3-2-9-7-12(8-10(9)6-11)15-5-1-4-14;/h2-3,6,12,15H,1,5,7-8H2;1H.
What are the key properties of 3-[(5-chloro-2,3-dihydro-1H-inden-2-yl)amino]propanenitrile;hydrochloride?
3-[(5-chloro-2,3-dihydro-1H-inden-2-yl)amino]propanenitrile;hydrochloride has a molecular weight of 257.16 g/mol, XLogP of 2.73, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(5-chloro-2,3-dihydro-1H-inden-2-yl)amino]propanenitrile;hydrochloride is sourced from PubChem (CID 3030828), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).