About 3-(dimethylamino)-1-(2,5-diphenylfuran-3-yl)propan-1-one;hydrochloride
3-(dimethylamino)-1-(2,5-diphenylfuran-3-yl)propan-1-one;hydrochloride (PubChem CID 3031057) has the molecular formula C21H22ClNO2
and a molecular weight of 355.87 g/mol. Its IUPAC name is 3-(dimethylamino)-1-(2,5-diphenylfuran-3-yl)propan-1-one;hydrochloride.
Molecular Properties
| Compound Name | 3-(dimethylamino)-1-(2,5-diphenylfuran-3-yl)propan-1-one;hydrochloride |
| PubChem CID | 3031057 |
| Molecular Formula | C21H22ClNO2 |
| Molecular Weight | 355.87 g/mol |
| Exact Mass | 355.13 |
| IUPAC Name | 3-(dimethylamino)-1-(2,5-diphenylfuran-3-yl)propan-1-one;hydrochloride |
| SMILES | CN(C)CCC(=O)c1cc(-c2ccccc2)oc1-c1ccccc1.Cl |
| InChI | InChI=1S/C21H21NO2.ClH/c1-22(2)14-13-19(23)18-15-20(16-9-5-3-6-10-16)24-21(18)17-11-7-4-8-12-17;/h3-12,15H,13-14H2,1-2H3;1H |
| InChIKey | HMCAPRJGFPJSBO-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 33.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 355.87 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(dimethylamino)-1-(2,5-diphenylfuran-3-yl)propan-1-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(dimethylamino)-1-(2,5-diphenylfuran-3-yl)propan-1-one;hydrochloride?
The IUPAC name of 3-(dimethylamino)-1-(2,5-diphenylfuran-3-yl)propan-1-one;hydrochloride (CID 3031057) is 3-(dimethylamino)-1-(2,5-diphenylfuran-3-yl)propan-1-one;hydrochloride.
What is the SMILES notation for 3-(dimethylamino)-1-(2,5-diphenylfuran-3-yl)propan-1-one;hydrochloride?
The canonical SMILES for 3-(dimethylamino)-1-(2,5-diphenylfuran-3-yl)propan-1-one;hydrochloride is CN(C)CCC(=O)c1cc(-c2ccccc2)oc1-c1ccccc1.Cl.
What is the InChIKey of 3-(dimethylamino)-1-(2,5-diphenylfuran-3-yl)propan-1-one;hydrochloride?
The InChIKey is HMCAPRJGFPJSBO-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H21NO2.ClH/c1-22(2)14-13-19(23)18-15-20(16-9-5-3-6-10-16)24-21(18)17-11-7-4-8-12-17;/h3-12,15H,13-14H2,1-2H3;1H.
What are the key properties of 3-(dimethylamino)-1-(2,5-diphenylfuran-3-yl)propan-1-one;hydrochloride?
3-(dimethylamino)-1-(2,5-diphenylfuran-3-yl)propan-1-one;hydrochloride has a molecular weight of 355.87 g/mol, XLogP of 5.17, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(dimethylamino)-1-(2,5-diphenylfuran-3-yl)propan-1-one;hydrochloride is sourced from PubChem (CID 3031057), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).