About phenyl N-[1-[1-(2,3-dimethylphenyl)tetrazol-5-yl]cyclohexyl]carbamate
phenyl N-[1-[1-(2,3-dimethylphenyl)tetrazol-5-yl]cyclohexyl]carbamate (PubChem CID 30310810) has the molecular formula C22H25N5O2
and a molecular weight of 391.48 g/mol. Its IUPAC name is phenyl N-[1-[1-(2,3-dimethylphenyl)tetrazol-5-yl]cyclohexyl]carbamate.
Molecular Properties
| Compound Name | phenyl N-[1-[1-(2,3-dimethylphenyl)tetrazol-5-yl]cyclohexyl]carbamate |
| PubChem CID | 30310810 |
| Molecular Formula | C22H25N5O2 |
| Molecular Weight | 391.48 g/mol |
| Exact Mass | 391.20 |
| IUPAC Name | phenyl N-[1-[1-(2,3-dimethylphenyl)tetrazol-5-yl]cyclohexyl]carbamate |
| SMILES | Cc1cccc(-n2nnnc2C2(NC(=O)Oc3ccccc3)CCCCC2)c1C |
| InChI | InChI=1S/C22H25N5O2/c1-16-10-9-13-19(17(16)2)27-20(24-25-26-27)22(14-7-4-8-15-22)23-21(28)29-18-11-5-3-6-12-18/h3,5-6,9-13H,4,7-8,14-15H2,1-2H3,(H,23,28) |
| InChIKey | ZOIWQSCZGFJIIO-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 391.48 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze phenyl N-[1-[1-(2,3-dimethylphenyl)tetrazol-5-yl]cyclohexyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenyl N-[1-[1-(2,3-dimethylphenyl)tetrazol-5-yl]cyclohexyl]carbamate?
The IUPAC name of phenyl N-[1-[1-(2,3-dimethylphenyl)tetrazol-5-yl]cyclohexyl]carbamate (CID 30310810) is phenyl N-[1-[1-(2,3-dimethylphenyl)tetrazol-5-yl]cyclohexyl]carbamate.
What is the SMILES notation for phenyl N-[1-[1-(2,3-dimethylphenyl)tetrazol-5-yl]cyclohexyl]carbamate?
The canonical SMILES for phenyl N-[1-[1-(2,3-dimethylphenyl)tetrazol-5-yl]cyclohexyl]carbamate is Cc1cccc(-n2nnnc2C2(NC(=O)Oc3ccccc3)CCCCC2)c1C.
What is the InChIKey of phenyl N-[1-[1-(2,3-dimethylphenyl)tetrazol-5-yl]cyclohexyl]carbamate?
The InChIKey is ZOIWQSCZGFJIIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H25N5O2/c1-16-10-9-13-19(17(16)2)27-20(24-25-26-27)22(14-7-4-8-15-22)23-21(28)29-18-11-5-3-6-12-18/h3,5-6,9-13H,4,7-8,14-15H2,1-2H3,(H,23,28).
What are the key properties of phenyl N-[1-[1-(2,3-dimethylphenyl)tetrazol-5-yl]cyclohexyl]carbamate?
phenyl N-[1-[1-(2,3-dimethylphenyl)tetrazol-5-yl]cyclohexyl]carbamate has a molecular weight of 391.48 g/mol, XLogP of 4.23, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for phenyl N-[1-[1-(2,3-dimethylphenyl)tetrazol-5-yl]cyclohexyl]carbamate is sourced from PubChem (CID 30310810), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).