About 1-chloro-N,N-bis(2-chloroethyl)propan-1-amine;hydrochloride
1-chloro-N,N-bis(2-chloroethyl)propan-1-amine;hydrochloride (PubChem CID 3031200) has the molecular formula C7H15Cl4N
and a molecular weight of 255.02 g/mol. Its IUPAC name is 1-chloro-N,N-bis(2-chloroethyl)propan-1-amine;hydrochloride.
Molecular Properties
| Compound Name | 1-chloro-N,N-bis(2-chloroethyl)propan-1-amine;hydrochloride |
| PubChem CID | 3031200 |
| Molecular Formula | C7H15Cl4N |
| Molecular Weight | 255.02 g/mol |
| Exact Mass | 253.00 |
| IUPAC Name | 1-chloro-N,N-bis(2-chloroethyl)propan-1-amine;hydrochloride |
| SMILES | CCC(Cl)N(CCCl)CCCl.Cl |
| InChI | InChI=1S/C7H14Cl3N.ClH/c1-2-7(10)11(5-3-8)6-4-9;/h7H,2-6H2,1H3;1H |
| InChIKey | AENKUPWBHZKZAX-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.02 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 1-chloro-N,N-bis(2-chloroethyl)propan-1-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-N,N-bis(2-chloroethyl)propan-1-amine;hydrochloride?
The IUPAC name of 1-chloro-N,N-bis(2-chloroethyl)propan-1-amine;hydrochloride (CID 3031200) is 1-chloro-N,N-bis(2-chloroethyl)propan-1-amine;hydrochloride.
What is the SMILES notation for 1-chloro-N,N-bis(2-chloroethyl)propan-1-amine;hydrochloride?
The canonical SMILES for 1-chloro-N,N-bis(2-chloroethyl)propan-1-amine;hydrochloride is CCC(Cl)N(CCCl)CCCl.Cl.
What is the InChIKey of 1-chloro-N,N-bis(2-chloroethyl)propan-1-amine;hydrochloride?
The InChIKey is AENKUPWBHZKZAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14Cl3N.ClH/c1-2-7(10)11(5-3-8)6-4-9;/h7H,2-6H2,1H3;1H.
What are the key properties of 1-chloro-N,N-bis(2-chloroethyl)propan-1-amine;hydrochloride?
1-chloro-N,N-bis(2-chloroethyl)propan-1-amine;hydrochloride has a molecular weight of 255.02 g/mol, XLogP of 3.16, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-N,N-bis(2-chloroethyl)propan-1-amine;hydrochloride is sourced from PubChem (CID 3031200), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).