About 4-[3-(2-bromophenyl)-3-oxopropyl]-1,2-diphenylpyrazolidine-3,5-dione
4-[3-(2-bromophenyl)-3-oxopropyl]-1,2-diphenylpyrazolidine-3,5-dione (PubChem CID 3031294) has the molecular formula C24H19BrN2O3
and a molecular weight of 463.33 g/mol. Its IUPAC name is 4-[3-(2-bromophenyl)-3-oxopropyl]-1,2-diphenylpyrazolidine-3,5-dione.
Molecular Properties
| Compound Name | 4-[3-(2-bromophenyl)-3-oxopropyl]-1,2-diphenylpyrazolidine-3,5-dione |
| PubChem CID | 3031294 |
| Molecular Formula | C24H19BrN2O3 |
| Molecular Weight | 463.33 g/mol |
| Exact Mass | 462.06 |
| IUPAC Name | 4-[3-(2-bromophenyl)-3-oxopropyl]-1,2-diphenylpyrazolidine-3,5-dione |
| SMILES | O=C(CCC1C(=O)N(c2ccccc2)N(c2ccccc2)C1=O)c1ccccc1Br |
| InChI | InChI=1S/C24H19BrN2O3/c25-21-14-8-7-13-19(21)22(28)16-15-20-23(29)26(17-9-3-1-4-10-17)27(24(20)30)18-11-5-2-6-12-18/h1-14,20H,15-16H2 |
| InChIKey | MEUCCOYGSIBKTD-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 463.33 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'keto_keto_beta_B(12)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 4-[3-(2-bromophenyl)-3-oxopropyl]-1,2-diphenylpyrazolidine-3,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3-(2-bromophenyl)-3-oxopropyl]-1,2-diphenylpyrazolidine-3,5-dione?
The IUPAC name of 4-[3-(2-bromophenyl)-3-oxopropyl]-1,2-diphenylpyrazolidine-3,5-dione (CID 3031294) is 4-[3-(2-bromophenyl)-3-oxopropyl]-1,2-diphenylpyrazolidine-3,5-dione.
What is the SMILES notation for 4-[3-(2-bromophenyl)-3-oxopropyl]-1,2-diphenylpyrazolidine-3,5-dione?
The canonical SMILES for 4-[3-(2-bromophenyl)-3-oxopropyl]-1,2-diphenylpyrazolidine-3,5-dione is O=C(CCC1C(=O)N(c2ccccc2)N(c2ccccc2)C1=O)c1ccccc1Br.
What is the InChIKey of 4-[3-(2-bromophenyl)-3-oxopropyl]-1,2-diphenylpyrazolidine-3,5-dione?
The InChIKey is MEUCCOYGSIBKTD-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H19BrN2O3/c25-21-14-8-7-13-19(21)22(28)16-15-20-23(29)26(17-9-3-1-4-10-17)27(24(20)30)18-11-5-2-6-12-18/h1-14,20H,15-16H2.
What are the key properties of 4-[3-(2-bromophenyl)-3-oxopropyl]-1,2-diphenylpyrazolidine-3,5-dione?
4-[3-(2-bromophenyl)-3-oxopropyl]-1,2-diphenylpyrazolidine-3,5-dione has a molecular weight of 463.33 g/mol, XLogP of 5.02, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3-(2-bromophenyl)-3-oxopropyl]-1,2-diphenylpyrazolidine-3,5-dione is sourced from PubChem (CID 3031294), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).