About 4-butyl-2-(6-fluoro-1,3-benzothiazol-2-yl)-5-methyl-1H-pyrazol-3-one
4-butyl-2-(6-fluoro-1,3-benzothiazol-2-yl)-5-methyl-1H-pyrazol-3-one (PubChem CID 3031318) has the molecular formula C15H16FN3OS
and a molecular weight of 305.38 g/mol. Its IUPAC name is 4-butyl-2-(6-fluoro-1,3-benzothiazol-2-yl)-5-methyl-1H-pyrazol-3-one.
Molecular Properties
| Compound Name | 4-butyl-2-(6-fluoro-1,3-benzothiazol-2-yl)-5-methyl-1H-pyrazol-3-one |
| PubChem CID | 3031318 |
| Molecular Formula | C15H16FN3OS |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.10 |
| IUPAC Name | 4-butyl-2-(6-fluoro-1,3-benzothiazol-2-yl)-5-methyl-1H-pyrazol-3-one |
| SMILES | CCCCc1c(C)[nH]n(-c2nc3ccc(F)cc3s2)c1=O |
| InChI | InChI=1S/C15H16FN3OS/c1-3-4-5-11-9(2)18-19(14(11)20)15-17-12-7-6-10(16)8-13(12)21-15/h6-8,18H,3-5H2,1-2H3 |
| InChIKey | ZAKMCPHRZQUITP-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 50.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-butyl-2-(6-fluoro-1,3-benzothiazol-2-yl)-5-methyl-1H-pyrazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-butyl-2-(6-fluoro-1,3-benzothiazol-2-yl)-5-methyl-1H-pyrazol-3-one?
The IUPAC name of 4-butyl-2-(6-fluoro-1,3-benzothiazol-2-yl)-5-methyl-1H-pyrazol-3-one (CID 3031318) is 4-butyl-2-(6-fluoro-1,3-benzothiazol-2-yl)-5-methyl-1H-pyrazol-3-one.
What is the SMILES notation for 4-butyl-2-(6-fluoro-1,3-benzothiazol-2-yl)-5-methyl-1H-pyrazol-3-one?
The canonical SMILES for 4-butyl-2-(6-fluoro-1,3-benzothiazol-2-yl)-5-methyl-1H-pyrazol-3-one is CCCCc1c(C)[nH]n(-c2nc3ccc(F)cc3s2)c1=O.
What is the InChIKey of 4-butyl-2-(6-fluoro-1,3-benzothiazol-2-yl)-5-methyl-1H-pyrazol-3-one?
The InChIKey is ZAKMCPHRZQUITP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16FN3OS/c1-3-4-5-11-9(2)18-19(14(11)20)15-17-12-7-6-10(16)8-13(12)21-15/h6-8,18H,3-5H2,1-2H3.
What are the key properties of 4-butyl-2-(6-fluoro-1,3-benzothiazol-2-yl)-5-methyl-1H-pyrazol-3-one?
4-butyl-2-(6-fluoro-1,3-benzothiazol-2-yl)-5-methyl-1H-pyrazol-3-one has a molecular weight of 305.38 g/mol, XLogP of 3.57, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-butyl-2-(6-fluoro-1,3-benzothiazol-2-yl)-5-methyl-1H-pyrazol-3-one is sourced from PubChem (CID 3031318), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).