About 6-hexoxypyridin-3-amine
6-hexoxypyridin-3-amine (PubChem CID 3031382) has the molecular formula C11H18N2O
and a molecular weight of 194.28 g/mol. Its IUPAC name is 6-hexoxypyridin-3-amine.
Molecular Properties
| Compound Name | 6-hexoxypyridin-3-amine |
| PubChem CID | 3031382 |
| Molecular Formula | C11H18N2O |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.14 |
| IUPAC Name | 6-hexoxypyridin-3-amine |
| SMILES | CCCCCCOc1ccc(N)cn1 |
| InChI | InChI=1S/C11H18N2O/c1-2-3-4-5-8-14-11-7-6-10(12)9-13-11/h6-7,9H,2-5,8,12H2,1H3 |
| InChIKey | MWBDWQQLFJCWQA-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-hexoxypyridin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-hexoxypyridin-3-amine?
The IUPAC name of 6-hexoxypyridin-3-amine (CID 3031382) is 6-hexoxypyridin-3-amine.
What is the SMILES notation for 6-hexoxypyridin-3-amine?
The canonical SMILES for 6-hexoxypyridin-3-amine is CCCCCCOc1ccc(N)cn1.
What is the InChIKey of 6-hexoxypyridin-3-amine?
The InChIKey is MWBDWQQLFJCWQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N2O/c1-2-3-4-5-8-14-11-7-6-10(12)9-13-11/h6-7,9H,2-5,8,12H2,1H3.
What are the key properties of 6-hexoxypyridin-3-amine?
6-hexoxypyridin-3-amine has a molecular weight of 194.28 g/mol, XLogP of 2.62, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-hexoxypyridin-3-amine is sourced from PubChem (CID 3031382), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).