About 3-methyl-2-pyridin-4-yl-1,3-oxazolidine
3-methyl-2-pyridin-4-yl-1,3-oxazolidine (PubChem CID 3031481) has the molecular formula C9H12N2O
and a molecular weight of 164.21 g/mol. Its IUPAC name is 3-methyl-2-pyridin-4-yl-1,3-oxazolidine.
Molecular Properties
| Compound Name | 3-methyl-2-pyridin-4-yl-1,3-oxazolidine |
| PubChem CID | 3031481 |
| Molecular Formula | C9H12N2O |
| Molecular Weight | 164.21 g/mol |
| Exact Mass | 164.09 |
| IUPAC Name | 3-methyl-2-pyridin-4-yl-1,3-oxazolidine |
| SMILES | CN1CCOC1c1ccncc1 |
| InChI | InChI=1S/C9H12N2O/c1-11-6-7-12-9(11)8-2-4-10-5-3-8/h2-5,9H,6-7H2,1H3 |
| InChIKey | CGNCQJWDILDMPF-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.21 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-methyl-2-pyridin-4-yl-1,3-oxazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-2-pyridin-4-yl-1,3-oxazolidine?
The IUPAC name of 3-methyl-2-pyridin-4-yl-1,3-oxazolidine (CID 3031481) is 3-methyl-2-pyridin-4-yl-1,3-oxazolidine.
What is the SMILES notation for 3-methyl-2-pyridin-4-yl-1,3-oxazolidine?
The canonical SMILES for 3-methyl-2-pyridin-4-yl-1,3-oxazolidine is CN1CCOC1c1ccncc1.
What is the InChIKey of 3-methyl-2-pyridin-4-yl-1,3-oxazolidine?
The InChIKey is CGNCQJWDILDMPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2O/c1-11-6-7-12-9(11)8-2-4-10-5-3-8/h2-5,9H,6-7H2,1H3.
What are the key properties of 3-methyl-2-pyridin-4-yl-1,3-oxazolidine?
3-methyl-2-pyridin-4-yl-1,3-oxazolidine has a molecular weight of 164.21 g/mol, XLogP of 1.04, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-2-pyridin-4-yl-1,3-oxazolidine is sourced from PubChem (CID 3031481), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).