C15H22ClN — CID 3031486
1-butyl-4-phenyl-3,6-dihydro-2H-pyridine;hydrochloride (PubChem CID 3031486) has the molecular formula C15H22ClN and a molecular weight of 251.80 g/mol. Its IUPAC name is 1-butyl-4-phenyl-3,6-dihydro-2H-pyridine;hydrochloride.
| Compound Name | 1-butyl-4-phenyl-3,6-dihydro-2H-pyridine;hydrochloride |
|---|---|
| PubChem CID | 3031486 |
| Molecular Formula | C15H22ClN |
| Molecular Weight | 251.80 g/mol |
| Exact Mass | 251.14 |
| IUPAC Name | 1-butyl-4-phenyl-3,6-dihydro-2H-pyridine;hydrochloride |
| SMILES | CCCCN1CC=C(c2ccccc2)CC1.Cl |
| InChI | InChI=1S/C15H21N.ClH/c1-2-3-11-16-12-9-15(10-13-16)14-7-5-4-6-8-14;/h4-9H,2-3,10-13H2,1H3;1H |
| InChIKey | YRZHPDJSZZXTFB-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.80 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |