C24H31BrN2 — CID 3031587
2,2-diphenyl-4-(1,2,2,4-tetramethylpyrrolidin-1-ium-1-yl)butanenitrile bromide (PubChem CID 3031587) has the molecular formula C24H31BrN2 and a molecular weight of 427.43 g/mol. Its IUPAC name is 2,2-diphenyl-4-(1,2,2,4-tetramethylpyrrolidin-1-ium-1-yl)butanenitrile bromide.
| Compound Name | 2,2-diphenyl-4-(1,2,2,4-tetramethylpyrrolidin-1-ium-1-yl)butanenitrile bromide |
|---|---|
| PubChem CID | 3031587 |
| Molecular Formula | C24H31BrN2 |
| Molecular Weight | 427.43 g/mol |
| Exact Mass | 426.17 |
| IUPAC Name | 2,2-diphenyl-4-(1,2,2,4-tetramethylpyrrolidin-1-ium-1-yl)butanenitrile bromide |
| SMILES | CC1CC(C)(C)[N+](C)(CCC(C#N)(c2ccccc2)c2ccccc2)C1.[Br-] |
| InChI | InChI=1S/C24H31N2.BrH/c1-20-17-23(2,3)26(4,18-20)16-15-24(19-25,21-11-7-5-8-12-21)22-13-9-6-10-14-22;/h5-14,20H,15-18H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | DVOGHFZCTXXMPB-UHFFFAOYSA-M |
| XLogP | 2.16 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.43 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|