About 3-carbazol-9-yl-N,N-dimethylpropan-1-amine
3-carbazol-9-yl-N,N-dimethylpropan-1-amine (PubChem CID 30316) has the molecular formula C17H20N2
and a molecular weight of 252.36 g/mol. Its IUPAC name is 3-carbazol-9-yl-N,N-dimethylpropan-1-amine.
Molecular Properties
| Compound Name | 3-carbazol-9-yl-N,N-dimethylpropan-1-amine |
| PubChem CID | 30316 |
| Molecular Formula | C17H20N2 |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.16 |
| IUPAC Name | 3-carbazol-9-yl-N,N-dimethylpropan-1-amine |
| SMILES | CN(C)CCCn1c2ccccc2c2ccccc21 |
| InChI | InChI=1S/C17H20N2/c1-18(2)12-7-13-19-16-10-5-3-8-14(16)15-9-4-6-11-17(15)19/h3-6,8-11H,7,12-13H2,1-2H3 |
| InChIKey | YSZTZAYSHQJVQU-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-carbazol-9-yl-N,N-dimethylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-carbazol-9-yl-N,N-dimethylpropan-1-amine?
The IUPAC name of 3-carbazol-9-yl-N,N-dimethylpropan-1-amine (CID 30316) is 3-carbazol-9-yl-N,N-dimethylpropan-1-amine.
What is the SMILES notation for 3-carbazol-9-yl-N,N-dimethylpropan-1-amine?
The canonical SMILES for 3-carbazol-9-yl-N,N-dimethylpropan-1-amine is CN(C)CCCn1c2ccccc2c2ccccc21.
What is the InChIKey of 3-carbazol-9-yl-N,N-dimethylpropan-1-amine?
The InChIKey is YSZTZAYSHQJVQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20N2/c1-18(2)12-7-13-19-16-10-5-3-8-14(16)15-9-4-6-11-17(15)19/h3-6,8-11H,7,12-13H2,1-2H3.
What are the key properties of 3-carbazol-9-yl-N,N-dimethylpropan-1-amine?
3-carbazol-9-yl-N,N-dimethylpropan-1-amine has a molecular weight of 252.36 g/mol, XLogP of 3.75, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-carbazol-9-yl-N,N-dimethylpropan-1-amine is sourced from PubChem (CID 30316), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).