About 4-N-(7-bromoquinolin-4-yl)-1-N,1-N-diethylpentane-1,4-diamine
4-N-(7-bromoquinolin-4-yl)-1-N,1-N-diethylpentane-1,4-diamine (PubChem CID 3031733) has the molecular formula C18H26BrN3
and a molecular weight of 364.33 g/mol. Its IUPAC name is 4-N-(7-bromoquinolin-4-yl)-1-N,1-N-diethylpentane-1,4-diamine.
Molecular Properties
| Compound Name | 4-N-(7-bromoquinolin-4-yl)-1-N,1-N-diethylpentane-1,4-diamine |
| PubChem CID | 3031733 |
| Molecular Formula | C18H26BrN3 |
| Molecular Weight | 364.33 g/mol |
| Exact Mass | 363.13 |
| IUPAC Name | 4-N-(7-bromoquinolin-4-yl)-1-N,1-N-diethylpentane-1,4-diamine |
| SMILES | CCN(CC)CCCC(C)Nc1ccnc2cc(Br)ccc12 |
| InChI | InChI=1S/C18H26BrN3/c1-4-22(5-2)12-6-7-14(3)21-17-10-11-20-18-13-15(19)8-9-16(17)18/h8-11,13-14H,4-7,12H2,1-3H3,(H,20,21) |
| InChIKey | GDCDHNUYXXZRKA-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.33 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-N-(7-bromoquinolin-4-yl)-1-N,1-N-diethylpentane-1,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-N-(7-bromoquinolin-4-yl)-1-N,1-N-diethylpentane-1,4-diamine?
The IUPAC name of 4-N-(7-bromoquinolin-4-yl)-1-N,1-N-diethylpentane-1,4-diamine (CID 3031733) is 4-N-(7-bromoquinolin-4-yl)-1-N,1-N-diethylpentane-1,4-diamine.
What is the SMILES notation for 4-N-(7-bromoquinolin-4-yl)-1-N,1-N-diethylpentane-1,4-diamine?
The canonical SMILES for 4-N-(7-bromoquinolin-4-yl)-1-N,1-N-diethylpentane-1,4-diamine is CCN(CC)CCCC(C)Nc1ccnc2cc(Br)ccc12.
What is the InChIKey of 4-N-(7-bromoquinolin-4-yl)-1-N,1-N-diethylpentane-1,4-diamine?
The InChIKey is GDCDHNUYXXZRKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H26BrN3/c1-4-22(5-2)12-6-7-14(3)21-17-10-11-20-18-13-15(19)8-9-16(17)18/h8-11,13-14H,4-7,12H2,1-3H3,(H,20,21).
What are the key properties of 4-N-(7-bromoquinolin-4-yl)-1-N,1-N-diethylpentane-1,4-diamine?
4-N-(7-bromoquinolin-4-yl)-1-N,1-N-diethylpentane-1,4-diamine has a molecular weight of 364.33 g/mol, XLogP of 4.92, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-N-(7-bromoquinolin-4-yl)-1-N,1-N-diethylpentane-1,4-diamine is sourced from PubChem (CID 3031733), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).