About 1-cyclohexyl-N,N-diethyltetrazol-5-amine;hydrochloride
1-cyclohexyl-N,N-diethyltetrazol-5-amine;hydrochloride (PubChem CID 3031883) has the molecular formula C11H22ClN5
and a molecular weight of 259.78 g/mol. Its IUPAC name is 1-cyclohexyl-N,N-diethyltetrazol-5-amine;hydrochloride.
Molecular Properties
| Compound Name | 1-cyclohexyl-N,N-diethyltetrazol-5-amine;hydrochloride |
| PubChem CID | 3031883 |
| Molecular Formula | C11H22ClN5 |
| Molecular Weight | 259.78 g/mol |
| Exact Mass | 259.16 |
| IUPAC Name | 1-cyclohexyl-N,N-diethyltetrazol-5-amine;hydrochloride |
| SMILES | CCN(CC)c1nnnn1C1CCCCC1.Cl |
| InChI | InChI=1S/C11H21N5.ClH/c1-3-15(4-2)11-12-13-14-16(11)10-8-6-5-7-9-10;/h10H,3-9H2,1-2H3;1H |
| InChIKey | AEGONJLTEDOYEP-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.78 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-cyclohexyl-N,N-diethyltetrazol-5-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohexyl-N,N-diethyltetrazol-5-amine;hydrochloride?
The IUPAC name of 1-cyclohexyl-N,N-diethyltetrazol-5-amine;hydrochloride (CID 3031883) is 1-cyclohexyl-N,N-diethyltetrazol-5-amine;hydrochloride.
What is the SMILES notation for 1-cyclohexyl-N,N-diethyltetrazol-5-amine;hydrochloride?
The canonical SMILES for 1-cyclohexyl-N,N-diethyltetrazol-5-amine;hydrochloride is CCN(CC)c1nnnn1C1CCCCC1.Cl.
What is the InChIKey of 1-cyclohexyl-N,N-diethyltetrazol-5-amine;hydrochloride?
The InChIKey is AEGONJLTEDOYEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21N5.ClH/c1-3-15(4-2)11-12-13-14-16(11)10-8-6-5-7-9-10;/h10H,3-9H2,1-2H3;1H.
What are the key properties of 1-cyclohexyl-N,N-diethyltetrazol-5-amine;hydrochloride?
1-cyclohexyl-N,N-diethyltetrazol-5-amine;hydrochloride has a molecular weight of 259.78 g/mol, XLogP of 2.45, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohexyl-N,N-diethyltetrazol-5-amine;hydrochloride is sourced from PubChem (CID 3031883), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).