About 2-(4-aminophenyl)-3-[3-(butylamino)propyl]-1,3-thiazolidin-4-one;hydrochloride
2-(4-aminophenyl)-3-[3-(butylamino)propyl]-1,3-thiazolidin-4-one;hydrochloride (PubChem CID 3031975) has the molecular formula C16H26ClN3OS
and a molecular weight of 343.92 g/mol. Its IUPAC name is 2-(4-aminophenyl)-3-[3-(butylamino)propyl]-1,3-thiazolidin-4-one;hydrochloride.
Molecular Properties
| Compound Name | 2-(4-aminophenyl)-3-[3-(butylamino)propyl]-1,3-thiazolidin-4-one;hydrochloride |
| PubChem CID | 3031975 |
| Molecular Formula | C16H26ClN3OS |
| Molecular Weight | 343.92 g/mol |
| Exact Mass | 343.15 |
| IUPAC Name | 2-(4-aminophenyl)-3-[3-(butylamino)propyl]-1,3-thiazolidin-4-one;hydrochloride |
| SMILES | CCCCNCCCN1C(=O)CSC1c1ccc(N)cc1.Cl |
| InChI | InChI=1S/C16H25N3OS.ClH/c1-2-3-9-18-10-4-11-19-15(20)12-21-16(19)13-5-7-14(17)8-6-13;/h5-8,16,18H,2-4,9-12,17H2,1H3;1H |
| InChIKey | VDVJFQAMJBUSCM-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.92 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-aminophenyl)-3-[3-(butylamino)propyl]-1,3-thiazolidin-4-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-aminophenyl)-3-[3-(butylamino)propyl]-1,3-thiazolidin-4-one;hydrochloride?
The IUPAC name of 2-(4-aminophenyl)-3-[3-(butylamino)propyl]-1,3-thiazolidin-4-one;hydrochloride (CID 3031975) is 2-(4-aminophenyl)-3-[3-(butylamino)propyl]-1,3-thiazolidin-4-one;hydrochloride.
What is the SMILES notation for 2-(4-aminophenyl)-3-[3-(butylamino)propyl]-1,3-thiazolidin-4-one;hydrochloride?
The canonical SMILES for 2-(4-aminophenyl)-3-[3-(butylamino)propyl]-1,3-thiazolidin-4-one;hydrochloride is CCCCNCCCN1C(=O)CSC1c1ccc(N)cc1.Cl.
What is the InChIKey of 2-(4-aminophenyl)-3-[3-(butylamino)propyl]-1,3-thiazolidin-4-one;hydrochloride?
The InChIKey is VDVJFQAMJBUSCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H25N3OS.ClH/c1-2-3-9-18-10-4-11-19-15(20)12-21-16(19)13-5-7-14(17)8-6-13;/h5-8,16,18H,2-4,9-12,17H2,1H3;1H.
What are the key properties of 2-(4-aminophenyl)-3-[3-(butylamino)propyl]-1,3-thiazolidin-4-one;hydrochloride?
2-(4-aminophenyl)-3-[3-(butylamino)propyl]-1,3-thiazolidin-4-one;hydrochloride has a molecular weight of 343.92 g/mol, XLogP of 3.04, 8 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-aminophenyl)-3-[3-(butylamino)propyl]-1,3-thiazolidin-4-one;hydrochloride is sourced from PubChem (CID 3031975), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).