About 1,3-dihydroindole-2-thione
1,3-dihydroindole-2-thione (PubChem CID 3032310) has the molecular formula C8H7NS
and a molecular weight of 149.22 g/mol. Its IUPAC name is 1,3-dihydroindole-2-thione.
Molecular Properties
| Compound Name | 1,3-dihydroindole-2-thione |
| PubChem CID | 3032310 |
| Molecular Formula | C8H7NS |
| Molecular Weight | 149.22 g/mol |
| Exact Mass | 149.03 |
| IUPAC Name | 1,3-dihydroindole-2-thione |
| SMILES | S=C1Cc2ccccc2N1 |
| InChI | InChI=1S/C8H7NS/c10-8-5-6-3-1-2-4-7(6)9-8/h1-4H,5H2,(H,9,10) |
| InChIKey | IGJWTYFTQNHSEK-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.22 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1,3-dihydroindole-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dihydroindole-2-thione?
The IUPAC name of 1,3-dihydroindole-2-thione (CID 3032310) is 1,3-dihydroindole-2-thione.
What is the SMILES notation for 1,3-dihydroindole-2-thione?
The canonical SMILES for 1,3-dihydroindole-2-thione is S=C1Cc2ccccc2N1.
What is the InChIKey of 1,3-dihydroindole-2-thione?
The InChIKey is IGJWTYFTQNHSEK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7NS/c10-8-5-6-3-1-2-4-7(6)9-8/h1-4H,5H2,(H,9,10).
What are the key properties of 1,3-dihydroindole-2-thione?
1,3-dihydroindole-2-thione has a molecular weight of 149.22 g/mol, XLogP of 1.98, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dihydroindole-2-thione is sourced from PubChem (CID 3032310), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).