About 1,3-dianilinothiourea
1,3-dianilinothiourea (PubChem CID 3032337) has the molecular formula C13H14N4S
and a molecular weight of 258.35 g/mol. Its IUPAC name is 1,3-dianilinothiourea.
Molecular Properties
| Compound Name | 1,3-dianilinothiourea |
| PubChem CID | 3032337 |
| Molecular Formula | C13H14N4S |
| Molecular Weight | 258.35 g/mol |
| Exact Mass | 258.09 |
| IUPAC Name | 1,3-dianilinothiourea |
| SMILES | S=C(NNc1ccccc1)NNc1ccccc1 |
| InChI | InChI=1S/C13H14N4S/c18-13(16-14-11-7-3-1-4-8-11)17-15-12-9-5-2-6-10-12/h1-10,14-15H,(H2,16,17,18) |
| InChIKey | BNSNUHPJRKTRNT-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 48.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.35 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1,3-dianilinothiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dianilinothiourea?
The IUPAC name of 1,3-dianilinothiourea (CID 3032337) is 1,3-dianilinothiourea.
What is the SMILES notation for 1,3-dianilinothiourea?
The canonical SMILES for 1,3-dianilinothiourea is S=C(NNc1ccccc1)NNc1ccccc1.
What is the InChIKey of 1,3-dianilinothiourea?
The InChIKey is BNSNUHPJRKTRNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14N4S/c18-13(16-14-11-7-3-1-4-8-11)17-15-12-9-5-2-6-10-12/h1-10,14-15H,(H2,16,17,18).
What are the key properties of 1,3-dianilinothiourea?
1,3-dianilinothiourea has a molecular weight of 258.35 g/mol, XLogP of 2.50, 4 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dianilinothiourea is sourced from PubChem (CID 3032337), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).