About 5,5-diphenylimidazolidine-2,4-dithione
5,5-diphenylimidazolidine-2,4-dithione (PubChem CID 3032419) has the molecular formula C15H12N2S2
and a molecular weight of 284.41 g/mol. Its IUPAC name is 5,5-diphenylimidazolidine-2,4-dithione.
Molecular Properties
| Compound Name | 5,5-diphenylimidazolidine-2,4-dithione |
| PubChem CID | 3032419 |
| Molecular Formula | C15H12N2S2 |
| Molecular Weight | 284.41 g/mol |
| Exact Mass | 284.04 |
| IUPAC Name | 5,5-diphenylimidazolidine-2,4-dithione |
| SMILES | S=C1NC(=S)C(c2ccccc2)(c2ccccc2)N1 |
| InChI | InChI=1S/C15H12N2S2/c18-13-15(17-14(19)16-13,11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10H,(H2,16,17,18,19) |
| InChIKey | IPDQDGCZABYZKF-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.41 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 5,5-diphenylimidazolidine-2,4-dithione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,5-diphenylimidazolidine-2,4-dithione?
The IUPAC name of 5,5-diphenylimidazolidine-2,4-dithione (CID 3032419) is 5,5-diphenylimidazolidine-2,4-dithione.
What is the SMILES notation for 5,5-diphenylimidazolidine-2,4-dithione?
The canonical SMILES for 5,5-diphenylimidazolidine-2,4-dithione is S=C1NC(=S)C(c2ccccc2)(c2ccccc2)N1.
What is the InChIKey of 5,5-diphenylimidazolidine-2,4-dithione?
The InChIKey is IPDQDGCZABYZKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12N2S2/c18-13-15(17-14(19)16-13,11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10H,(H2,16,17,18,19).
What are the key properties of 5,5-diphenylimidazolidine-2,4-dithione?
5,5-diphenylimidazolidine-2,4-dithione has a molecular weight of 284.41 g/mol, XLogP of 2.74, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,5-diphenylimidazolidine-2,4-dithione is sourced from PubChem (CID 3032419), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).