About 1,1,3-tributylthiourea
1,1,3-tributylthiourea (PubChem CID 3032425) has the molecular formula C13H28N2S
and a molecular weight of 244.45 g/mol. Its IUPAC name is 1,1,3-tributylthiourea.
Molecular Properties
| Compound Name | 1,1,3-tributylthiourea |
| PubChem CID | 3032425 |
| Molecular Formula | C13H28N2S |
| Molecular Weight | 244.45 g/mol |
| Exact Mass | 244.20 |
| IUPAC Name | 1,1,3-tributylthiourea |
| SMILES | CCCCNC(=S)N(CCCC)CCCC |
| InChI | InChI=1S/C13H28N2S/c1-4-7-10-14-13(16)15(11-8-5-2)12-9-6-3/h4-12H2,1-3H3,(H,14,16) |
| InChIKey | UDYXMTORTDACTG-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.45 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1,1,3-tributylthiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1,3-tributylthiourea?
The IUPAC name of 1,1,3-tributylthiourea (CID 3032425) is 1,1,3-tributylthiourea.
What is the SMILES notation for 1,1,3-tributylthiourea?
The canonical SMILES for 1,1,3-tributylthiourea is CCCCNC(=S)N(CCCC)CCCC.
What is the InChIKey of 1,1,3-tributylthiourea?
The InChIKey is UDYXMTORTDACTG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H28N2S/c1-4-7-10-14-13(16)15(11-8-5-2)12-9-6-3/h4-12H2,1-3H3,(H,14,16).
What are the key properties of 1,1,3-tributylthiourea?
1,1,3-tributylthiourea has a molecular weight of 244.45 g/mol, XLogP of 3.56, 9 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1,3-tributylthiourea is sourced from PubChem (CID 3032425), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).