C9H13N5S — CID 3032480
2,6-bis(prop-2-enylamino)-1H-1,3,5-triazine-4-thione (PubChem CID 3032480) has the molecular formula C9H13N5S and a molecular weight of 223.30 g/mol. Its IUPAC name is 2,6-bis(prop-2-enylamino)-1H-1,3,5-triazine-4-thione.
| Compound Name | 2,6-bis(prop-2-enylamino)-1H-1,3,5-triazine-4-thione |
|---|---|
| PubChem CID | 3032480 |
| Molecular Formula | C9H13N5S |
| Molecular Weight | 223.30 g/mol |
| Exact Mass | 223.09 |
| IUPAC Name | 2,6-bis(prop-2-enylamino)-1H-1,3,5-triazine-4-thione |
| SMILES | C=CCNc1nc(=S)nc(NCC=C)[nH]1 |
| InChI | InChI=1S/C9H13N5S/c1-3-5-10-7-12-8(11-6-4-2)14-9(15)13-7/h3-4H,1-2,5-6H2,(H3,10,11,12,13,14,15) |
| InChIKey | PGZBQVDAONZCLW-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 65.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.30 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|