About quinolin-8-yl 2,6-difluorobenzenesulfonate
quinolin-8-yl 2,6-difluorobenzenesulfonate (PubChem CID 30325132) has the molecular formula C15H9F2NO3S
and a molecular weight of 321.30 g/mol. Its IUPAC name is quinolin-8-yl 2,6-difluorobenzenesulfonate.
Molecular Properties
| Compound Name | quinolin-8-yl 2,6-difluorobenzenesulfonate |
| PubChem CID | 30325132 |
| Molecular Formula | C15H9F2NO3S |
| Molecular Weight | 321.30 g/mol |
| Exact Mass | 321.03 |
| IUPAC Name | quinolin-8-yl 2,6-difluorobenzenesulfonate |
| SMILES | O=S(=O)(Oc1cccc2cccnc12)c1c(F)cccc1F |
| InChI | InChI=1S/C15H9F2NO3S/c16-11-6-2-7-12(17)15(11)22(19,20)21-13-8-1-4-10-5-3-9-18-14(10)13/h1-9H |
| InChIKey | KQOUENBQZPSWHW-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.30 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze quinolin-8-yl 2,6-difluorobenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of quinolin-8-yl 2,6-difluorobenzenesulfonate?
The IUPAC name of quinolin-8-yl 2,6-difluorobenzenesulfonate (CID 30325132) is quinolin-8-yl 2,6-difluorobenzenesulfonate.
What is the SMILES notation for quinolin-8-yl 2,6-difluorobenzenesulfonate?
The canonical SMILES for quinolin-8-yl 2,6-difluorobenzenesulfonate is O=S(=O)(Oc1cccc2cccnc12)c1c(F)cccc1F.
What is the InChIKey of quinolin-8-yl 2,6-difluorobenzenesulfonate?
The InChIKey is KQOUENBQZPSWHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H9F2NO3S/c16-11-6-2-7-12(17)15(11)22(19,20)21-13-8-1-4-10-5-3-9-18-14(10)13/h1-9H.
What are the key properties of quinolin-8-yl 2,6-difluorobenzenesulfonate?
quinolin-8-yl 2,6-difluorobenzenesulfonate has a molecular weight of 321.30 g/mol, XLogP of 3.28, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for quinolin-8-yl 2,6-difluorobenzenesulfonate is sourced from PubChem (CID 30325132), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).