About methyl-oxo-phenylsilane
methyl-oxo-phenylsilane (PubChem CID 3032548) has the molecular formula C7H8OSi
and a molecular weight of 136.23 g/mol. Its IUPAC name is methyl-oxo-phenylsilane.
Molecular Properties
| Compound Name | methyl-oxo-phenylsilane |
| PubChem CID | 3032548 |
| Molecular Formula | C7H8OSi |
| Molecular Weight | 136.23 g/mol |
| Exact Mass | 136.03 |
| IUPAC Name | methyl-oxo-phenylsilane |
| SMILES | C[Si](=O)c1ccccc1 |
| InChI | InChI=1S/C7H8OSi/c1-9(8)7-5-3-2-4-6-7/h2-6H,1H3 |
| InChIKey | IXKNJYSAWNJQQY-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.23 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze methyl-oxo-phenylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl-oxo-phenylsilane?
The IUPAC name of methyl-oxo-phenylsilane (CID 3032548) is methyl-oxo-phenylsilane.
What is the SMILES notation for methyl-oxo-phenylsilane?
The canonical SMILES for methyl-oxo-phenylsilane is C[Si](=O)c1ccccc1.
What is the InChIKey of methyl-oxo-phenylsilane?
The InChIKey is IXKNJYSAWNJQQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8OSi/c1-9(8)7-5-3-2-4-6-7/h2-6H,1H3.
What are the key properties of methyl-oxo-phenylsilane?
methyl-oxo-phenylsilane has a molecular weight of 136.23 g/mol, XLogP of 0.95, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for methyl-oxo-phenylsilane is sourced from PubChem (CID 3032548), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).