About gold(1+);triethylphosphane;chloride
gold(1+);triethylphosphane;chloride (PubChem CID 3032639) has the molecular formula C6H15AuClP
and a molecular weight of 350.58 g/mol. Its IUPAC name is gold(1+);triethylphosphane;chloride.
Molecular Properties
| Compound Name | gold(1+);triethylphosphane;chloride |
| PubChem CID | 3032639 |
| Molecular Formula | C6H15AuClP |
| Molecular Weight | 350.58 g/mol |
| Exact Mass | 350.03 |
| IUPAC Name | gold(1+);triethylphosphane;chloride |
| SMILES | CCP(CC)CC.[Au+].[Cl-] |
| InChI | InChI=1S/C6H15P.Au.ClH/c1-4-7(5-2)6-3;;/h4-6H2,1-3H3;;1H/q;+1;/p-1 |
| InChIKey | SYBBXLKWGHAVHP-UHFFFAOYSA-M |
| XLogP | -0.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.58 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze gold(1+);triethylphosphane;chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of gold(1+);triethylphosphane;chloride?
The IUPAC name of gold(1+);triethylphosphane;chloride (CID 3032639) is gold(1+);triethylphosphane;chloride.
What is the SMILES notation for gold(1+);triethylphosphane;chloride?
The canonical SMILES for gold(1+);triethylphosphane;chloride is CCP(CC)CC.[Au+].[Cl-].
What is the InChIKey of gold(1+);triethylphosphane;chloride?
The InChIKey is SYBBXLKWGHAVHP-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H15P.Au.ClH/c1-4-7(5-2)6-3;;/h4-6H2,1-3H3;;1H/q;+1;/p-1.
What are the key properties of gold(1+);triethylphosphane;chloride?
gold(1+);triethylphosphane;chloride has a molecular weight of 350.58 g/mol, XLogP of -0.47, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for gold(1+);triethylphosphane;chloride is sourced from PubChem (CID 3032639), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).