About cyclohexylazanium;N-cyclohexylcarbamodithioate
cyclohexylazanium;N-cyclohexylcarbamodithioate (PubChem CID 3032686) has the molecular formula C13H26N2S2
and a molecular weight of 274.50 g/mol. Its IUPAC name is cyclohexylazanium;N-cyclohexylcarbamodithioate.
Molecular Properties
| Compound Name | cyclohexylazanium;N-cyclohexylcarbamodithioate |
| PubChem CID | 3032686 |
| Molecular Formula | C13H26N2S2 |
| Molecular Weight | 274.50 g/mol |
| Exact Mass | 274.15 |
| IUPAC Name | cyclohexylazanium;N-cyclohexylcarbamodithioate |
| SMILES | S=C([S-])NC1CCCCC1.[NH3+]C1CCCCC1 |
| InChI | InChI=1S/C7H13NS2.C6H13N/c9-7(10)8-6-4-2-1-3-5-6;7-6-4-2-1-3-5-6/h6H,1-5H2,(H2,8,9,10);6H,1-5,7H2 |
| InChIKey | JVFIYPNBHGUPJL-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 39.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.50 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze cyclohexylazanium;N-cyclohexylcarbamodithioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexylazanium;N-cyclohexylcarbamodithioate?
The IUPAC name of cyclohexylazanium;N-cyclohexylcarbamodithioate (CID 3032686) is cyclohexylazanium;N-cyclohexylcarbamodithioate.
What is the SMILES notation for cyclohexylazanium;N-cyclohexylcarbamodithioate?
The canonical SMILES for cyclohexylazanium;N-cyclohexylcarbamodithioate is S=C([S-])NC1CCCCC1.[NH3+]C1CCCCC1.
What is the InChIKey of cyclohexylazanium;N-cyclohexylcarbamodithioate?
The InChIKey is JVFIYPNBHGUPJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NS2.C6H13N/c9-7(10)8-6-4-2-1-3-5-6;7-6-4-2-1-3-5-6/h6H,1-5H2,(H2,8,9,10);6H,1-5,7H2.
What are the key properties of cyclohexylazanium;N-cyclohexylcarbamodithioate?
cyclohexylazanium;N-cyclohexylcarbamodithioate has a molecular weight of 274.50 g/mol, XLogP of 2.30, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexylazanium;N-cyclohexylcarbamodithioate is sourced from PubChem (CID 3032686), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).