About 1-(4-chlorophenyl)-3-(3,5-dimethylanilino)-6,7-dihydro-5H-indazol-4-one
1-(4-chlorophenyl)-3-(3,5-dimethylanilino)-6,7-dihydro-5H-indazol-4-one (PubChem CID 30327399) has the molecular formula C21H20ClN3O
and a molecular weight of 365.86 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-(3,5-dimethylanilino)-6,7-dihydro-5H-indazol-4-one.
Molecular Properties
| Compound Name | 1-(4-chlorophenyl)-3-(3,5-dimethylanilino)-6,7-dihydro-5H-indazol-4-one |
| PubChem CID | 30327399 |
| Molecular Formula | C21H20ClN3O |
| Molecular Weight | 365.86 g/mol |
| Exact Mass | 365.13 |
| IUPAC Name | 1-(4-chlorophenyl)-3-(3,5-dimethylanilino)-6,7-dihydro-5H-indazol-4-one |
| SMILES | Cc1cc(C)cc(Nc2nn(-c3ccc(Cl)cc3)c3c2C(=O)CCC3)c1 |
| InChI | InChI=1S/C21H20ClN3O/c1-13-10-14(2)12-16(11-13)23-21-20-18(4-3-5-19(20)26)25(24-21)17-8-6-15(22)7-9-17/h6-12H,3-5H2,1-2H3,(H,23,24) |
| InChIKey | OZPOHZFNYNPQIW-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 365.86 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(4-chlorophenyl)-3-(3,5-dimethylanilino)-6,7-dihydro-5H-indazol-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-chlorophenyl)-3-(3,5-dimethylanilino)-6,7-dihydro-5H-indazol-4-one?
The IUPAC name of 1-(4-chlorophenyl)-3-(3,5-dimethylanilino)-6,7-dihydro-5H-indazol-4-one (CID 30327399) is 1-(4-chlorophenyl)-3-(3,5-dimethylanilino)-6,7-dihydro-5H-indazol-4-one.
What is the SMILES notation for 1-(4-chlorophenyl)-3-(3,5-dimethylanilino)-6,7-dihydro-5H-indazol-4-one?
The canonical SMILES for 1-(4-chlorophenyl)-3-(3,5-dimethylanilino)-6,7-dihydro-5H-indazol-4-one is Cc1cc(C)cc(Nc2nn(-c3ccc(Cl)cc3)c3c2C(=O)CCC3)c1.
What is the InChIKey of 1-(4-chlorophenyl)-3-(3,5-dimethylanilino)-6,7-dihydro-5H-indazol-4-one?
The InChIKey is OZPOHZFNYNPQIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H20ClN3O/c1-13-10-14(2)12-16(11-13)23-21-20-18(4-3-5-19(20)26)25(24-21)17-8-6-15(22)7-9-17/h6-12H,3-5H2,1-2H3,(H,23,24).
What are the key properties of 1-(4-chlorophenyl)-3-(3,5-dimethylanilino)-6,7-dihydro-5H-indazol-4-one?
1-(4-chlorophenyl)-3-(3,5-dimethylanilino)-6,7-dihydro-5H-indazol-4-one has a molecular weight of 365.86 g/mol, XLogP of 5.41, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-chlorophenyl)-3-(3,5-dimethylanilino)-6,7-dihydro-5H-indazol-4-one is sourced from PubChem (CID 30327399), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).