About 4,4-dimethyl-1H-3,1-benzoxazine-2-thione
4,4-dimethyl-1H-3,1-benzoxazine-2-thione (PubChem CID 3032785) has the molecular formula C10H11NOS
and a molecular weight of 193.27 g/mol. Its IUPAC name is 4,4-dimethyl-1H-3,1-benzoxazine-2-thione.
Molecular Properties
| Compound Name | 4,4-dimethyl-1H-3,1-benzoxazine-2-thione |
| PubChem CID | 3032785 |
| Molecular Formula | C10H11NOS |
| Molecular Weight | 193.27 g/mol |
| Exact Mass | 193.06 |
| IUPAC Name | 4,4-dimethyl-1H-3,1-benzoxazine-2-thione |
| SMILES | CC1(C)OC(=S)Nc2ccccc21 |
| InChI | InChI=1S/C10H11NOS/c1-10(2)7-5-3-4-6-8(7)11-9(13)12-10/h3-6H,1-2H3,(H,11,13) |
| InChIKey | DCXHYBSZULGYNI-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.27 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 4,4-dimethyl-1H-3,1-benzoxazine-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,4-dimethyl-1H-3,1-benzoxazine-2-thione?
The IUPAC name of 4,4-dimethyl-1H-3,1-benzoxazine-2-thione (CID 3032785) is 4,4-dimethyl-1H-3,1-benzoxazine-2-thione.
What is the SMILES notation for 4,4-dimethyl-1H-3,1-benzoxazine-2-thione?
The canonical SMILES for 4,4-dimethyl-1H-3,1-benzoxazine-2-thione is CC1(C)OC(=S)Nc2ccccc21.
What is the InChIKey of 4,4-dimethyl-1H-3,1-benzoxazine-2-thione?
The InChIKey is DCXHYBSZULGYNI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NOS/c1-10(2)7-5-3-4-6-8(7)11-9(13)12-10/h3-6H,1-2H3,(H,11,13).
What are the key properties of 4,4-dimethyl-1H-3,1-benzoxazine-2-thione?
4,4-dimethyl-1H-3,1-benzoxazine-2-thione has a molecular weight of 193.27 g/mol, XLogP of 2.65, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4-dimethyl-1H-3,1-benzoxazine-2-thione is sourced from PubChem (CID 3032785), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).