C12H2Br8 — CID 3032840
1,2,3,4,5-pentabromo-6-(2,3,4-tribromophenyl)benzene (PubChem CID 3032840) has the molecular formula C12H2Br8 and a molecular weight of 785.38 g/mol. Its IUPAC name is 1,2,3,4,5-pentabromo-6-(2,3,4-tribromophenyl)benzene.
| Compound Name | 1,2,3,4,5-pentabromo-6-(2,3,4-tribromophenyl)benzene |
|---|---|
| PubChem CID | 3032840 |
| Molecular Formula | C12H2Br8 |
| Molecular Weight | 785.38 g/mol |
| Exact Mass | 777.36 |
| IUPAC Name | 1,2,3,4,5-pentabromo-6-(2,3,4-tribromophenyl)benzene |
| SMILES | Brc1ccc(-c2c(Br)c(Br)c(Br)c(Br)c2Br)c(Br)c1Br |
| InChI | InChI=1S/C12H2Br8/c13-4-2-1-3(6(14)7(4)15)5-8(16)10(18)12(20)11(19)9(5)17/h1-2H |
| InChIKey | NDRKXFLZSRHAJE-UHFFFAOYSA-N |
| XLogP | 9.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 785.38 |
| LogP ≤ 5 | 9.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|