About N'-hexylhexanediamide
N'-hexylhexanediamide (PubChem CID 3032893) has the molecular formula C12H24N2O2
and a molecular weight of 228.34 g/mol. Its IUPAC name is N'-hexylhexanediamide.
Molecular Properties
| Compound Name | N'-hexylhexanediamide |
| PubChem CID | 3032893 |
| Molecular Formula | C12H24N2O2 |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.18 |
| IUPAC Name | N'-hexylhexanediamide |
| SMILES | CCCCCCNC(=O)CCCCC(N)=O |
| InChI | InChI=1S/C12H24N2O2/c1-2-3-4-7-10-14-12(16)9-6-5-8-11(13)15/h2-10H2,1H3,(H2,13,15)(H,14,16) |
| InChIKey | QDBQXOAICGSACD-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N'-hexylhexanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-hexylhexanediamide?
The IUPAC name of N'-hexylhexanediamide (CID 3032893) is N'-hexylhexanediamide.
What is the SMILES notation for N'-hexylhexanediamide?
The canonical SMILES for N'-hexylhexanediamide is CCCCCCNC(=O)CCCCC(N)=O.
What is the InChIKey of N'-hexylhexanediamide?
The InChIKey is QDBQXOAICGSACD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24N2O2/c1-2-3-4-7-10-14-12(16)9-6-5-8-11(13)15/h2-10H2,1H3,(H2,13,15)(H,14,16).
What are the key properties of N'-hexylhexanediamide?
N'-hexylhexanediamide has a molecular weight of 228.34 g/mol, XLogP of 1.73, 10 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-hexylhexanediamide is sourced from PubChem (CID 3032893), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).