C12H11I3N2O4 — CID 3032900
3-acetamido-2,4,6-triiodo-5-[2-(methylamino)-2-oxoethyl]benzoic acid (PubChem CID 3032900) has the molecular formula C12H11I3N2O4 and a molecular weight of 627.94 g/mol. Its IUPAC name is 3-acetamido-2,4,6-triiodo-5-[2-(methylamino)-2-oxoethyl]benzoic acid.
| Compound Name | 3-acetamido-2,4,6-triiodo-5-[2-(methylamino)-2-oxoethyl]benzoic acid |
|---|---|
| PubChem CID | 3032900 |
| Molecular Formula | C12H11I3N2O4 |
| Molecular Weight | 627.94 g/mol |
| Exact Mass | 627.79 |
| IUPAC Name | 3-acetamido-2,4,6-triiodo-5-[2-(methylamino)-2-oxoethyl]benzoic acid |
| SMILES | CNC(=O)Cc1c(I)c(NC(C)=O)c(I)c(C(=O)O)c1I |
| InChI | InChI=1S/C12H11I3N2O4/c1-4(18)17-11-9(14)5(3-6(19)16-2)8(13)7(10(11)15)12(20)21/h3H2,1-2H3,(H,16,19)(H,17,18)(H,20,21) |
| InChIKey | PLROFPAIYINOGV-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.94 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|