C26H18N4O2 — CID 30329289
4-phenyl-N-[2-(3-pyridin-2-yl-1,2,4-oxadiazol-5-yl)phenyl]benzamide (PubChem CID 30329289) has the molecular formula C26H18N4O2 and a molecular weight of 418.46 g/mol. Its IUPAC name is 4-phenyl-N-[2-(3-pyridin-2-yl-1,2,4-oxadiazol-5-yl)phenyl]benzamide.
| Compound Name | 4-phenyl-N-[2-(3-pyridin-2-yl-1,2,4-oxadiazol-5-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 30329289 |
| Molecular Formula | C26H18N4O2 |
| Molecular Weight | 418.46 g/mol |
| Exact Mass | 418.14 |
| IUPAC Name | 4-phenyl-N-[2-(3-pyridin-2-yl-1,2,4-oxadiazol-5-yl)phenyl]benzamide |
| SMILES | O=C(Nc1ccccc1-c1nc(-c2ccccn2)no1)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C26H18N4O2/c31-25(20-15-13-19(14-16-20)18-8-2-1-3-9-18)28-22-11-5-4-10-21(22)26-29-24(30-32-26)23-12-6-7-17-27-23/h1-17H,(H,28,31) |
| InChIKey | DGOKRJCQOKRJSD-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 80.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.46 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |