C22H15ClN4O5 — CID 30330377
2-chloro-4-nitro-N-[2-[3-(phenoxymethyl)-1,2,4-oxadiazol-5-yl]phenyl]benzamide (PubChem CID 30330377) has the molecular formula C22H15ClN4O5 and a molecular weight of 450.84 g/mol. Its IUPAC name is 2-chloro-4-nitro-N-[2-[3-(phenoxymethyl)-1,2,4-oxadiazol-5-yl]phenyl]benzamide.
| Compound Name | 2-chloro-4-nitro-N-[2-[3-(phenoxymethyl)-1,2,4-oxadiazol-5-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 30330377 |
| Molecular Formula | C22H15ClN4O5 |
| Molecular Weight | 450.84 g/mol |
| Exact Mass | 450.07 |
| IUPAC Name | 2-chloro-4-nitro-N-[2-[3-(phenoxymethyl)-1,2,4-oxadiazol-5-yl]phenyl]benzamide |
| SMILES | O=C(Nc1ccccc1-c1nc(COc2ccccc2)no1)c1ccc([N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C22H15ClN4O5/c23-18-12-14(27(29)30)10-11-16(18)21(28)24-19-9-5-4-8-17(19)22-25-20(26-32-22)13-31-15-6-2-1-3-7-15/h1-12H,13H2,(H,24,28) |
| InChIKey | LNCGVEFASWWFBI-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 120.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.84 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|