About 2-(diethoxymethyl)-2,5-diethoxyoxolane
2-(diethoxymethyl)-2,5-diethoxyoxolane (PubChem CID 3033194) has the molecular formula C13H26O5
and a molecular weight of 262.35 g/mol. Its IUPAC name is 2-(diethoxymethyl)-2,5-diethoxyoxolane.
Molecular Properties
| Compound Name | 2-(diethoxymethyl)-2,5-diethoxyoxolane |
| PubChem CID | 3033194 |
| Molecular Formula | C13H26O5 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.18 |
| IUPAC Name | 2-(diethoxymethyl)-2,5-diethoxyoxolane |
| SMILES | CCOC1CCC(OCC)(C(OCC)OCC)O1 |
| InChI | InChI=1S/C13H26O5/c1-5-14-11-9-10-13(18-11,17-8-4)12(15-6-2)16-7-3/h11-12H,5-10H2,1-4H3 |
| InChIKey | WAIRCAVHNPYSNP-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-(diethoxymethyl)-2,5-diethoxyoxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(diethoxymethyl)-2,5-diethoxyoxolane?
The IUPAC name of 2-(diethoxymethyl)-2,5-diethoxyoxolane (CID 3033194) is 2-(diethoxymethyl)-2,5-diethoxyoxolane.
What is the SMILES notation for 2-(diethoxymethyl)-2,5-diethoxyoxolane?
The canonical SMILES for 2-(diethoxymethyl)-2,5-diethoxyoxolane is CCOC1CCC(OCC)(C(OCC)OCC)O1.
What is the InChIKey of 2-(diethoxymethyl)-2,5-diethoxyoxolane?
The InChIKey is WAIRCAVHNPYSNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26O5/c1-5-14-11-9-10-13(18-11,17-8-4)12(15-6-2)16-7-3/h11-12H,5-10H2,1-4H3.
What are the key properties of 2-(diethoxymethyl)-2,5-diethoxyoxolane?
2-(diethoxymethyl)-2,5-diethoxyoxolane has a molecular weight of 262.35 g/mol, XLogP of 2.29, 9 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(diethoxymethyl)-2,5-diethoxyoxolane is sourced from PubChem (CID 3033194), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).