About N-[2-[3-(furan-2-yl)-1,2,4-oxadiazol-5-yl]phenyl]thiophene-2-carboxamide
N-[2-[3-(furan-2-yl)-1,2,4-oxadiazol-5-yl]phenyl]thiophene-2-carboxamide (PubChem CID 30332108) has the molecular formula C17H11N3O3S
and a molecular weight of 337.36 g/mol. Its IUPAC name is N-[2-[3-(furan-2-yl)-1,2,4-oxadiazol-5-yl]phenyl]thiophene-2-carboxamide.
Molecular Properties
| Compound Name | N-[2-[3-(furan-2-yl)-1,2,4-oxadiazol-5-yl]phenyl]thiophene-2-carboxamide |
| PubChem CID | 30332108 |
| Molecular Formula | C17H11N3O3S |
| Molecular Weight | 337.36 g/mol |
| Exact Mass | 337.05 |
| IUPAC Name | N-[2-[3-(furan-2-yl)-1,2,4-oxadiazol-5-yl]phenyl]thiophene-2-carboxamide |
| SMILES | O=C(Nc1ccccc1-c1nc(-c2ccco2)no1)c1cccs1 |
| InChI | InChI=1S/C17H11N3O3S/c21-16(14-8-4-10-24-14)18-12-6-2-1-5-11(12)17-19-15(20-23-17)13-7-3-9-22-13/h1-10H,(H,18,21) |
| InChIKey | ZXYHYAHYSGLNDD-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.36 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[2-[3-(furan-2-yl)-1,2,4-oxadiazol-5-yl]phenyl]thiophene-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-[3-(furan-2-yl)-1,2,4-oxadiazol-5-yl]phenyl]thiophene-2-carboxamide?
The IUPAC name of N-[2-[3-(furan-2-yl)-1,2,4-oxadiazol-5-yl]phenyl]thiophene-2-carboxamide (CID 30332108) is N-[2-[3-(furan-2-yl)-1,2,4-oxadiazol-5-yl]phenyl]thiophene-2-carboxamide.
What is the SMILES notation for N-[2-[3-(furan-2-yl)-1,2,4-oxadiazol-5-yl]phenyl]thiophene-2-carboxamide?
The canonical SMILES for N-[2-[3-(furan-2-yl)-1,2,4-oxadiazol-5-yl]phenyl]thiophene-2-carboxamide is O=C(Nc1ccccc1-c1nc(-c2ccco2)no1)c1cccs1.
What is the InChIKey of N-[2-[3-(furan-2-yl)-1,2,4-oxadiazol-5-yl]phenyl]thiophene-2-carboxamide?
The InChIKey is ZXYHYAHYSGLNDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H11N3O3S/c21-16(14-8-4-10-24-14)18-12-6-2-1-5-11(12)17-19-15(20-23-17)13-7-3-9-22-13/h1-10H,(H,18,21).
What are the key properties of N-[2-[3-(furan-2-yl)-1,2,4-oxadiazol-5-yl]phenyl]thiophene-2-carboxamide?
N-[2-[3-(furan-2-yl)-1,2,4-oxadiazol-5-yl]phenyl]thiophene-2-carboxamide has a molecular weight of 337.36 g/mol, XLogP of 4.31, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-[3-(furan-2-yl)-1,2,4-oxadiazol-5-yl]phenyl]thiophene-2-carboxamide is sourced from PubChem (CID 30332108), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).