C19H14N4O3S — CID 30332686
N-[2-(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)phenyl]benzenesulfonamide (PubChem CID 30332686) has the molecular formula C19H14N4O3S and a molecular weight of 378.41 g/mol. Its IUPAC name is N-[2-(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)phenyl]benzenesulfonamide.
| Compound Name | N-[2-(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 30332686 |
| Molecular Formula | C19H14N4O3S |
| Molecular Weight | 378.41 g/mol |
| Exact Mass | 378.08 |
| IUPAC Name | N-[2-(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)phenyl]benzenesulfonamide |
| SMILES | O=S(=O)(Nc1ccccc1-c1nc(-c2cccnc2)no1)c1ccccc1 |
| InChI | InChI=1S/C19H14N4O3S/c24-27(25,15-8-2-1-3-9-15)23-17-11-5-4-10-16(17)19-21-18(22-26-19)14-7-6-12-20-13-14/h1-13,23H |
| InChIKey | BYJZHFCHYTYLSF-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 97.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.41 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |