About 2-fluoroethyl 9-fluorodecanoate
2-fluoroethyl 9-fluorodecanoate (PubChem CID 3033283) has the molecular formula C12H22F2O2
and a molecular weight of 236.30 g/mol. Its IUPAC name is 2-fluoroethyl 9-fluorodecanoate.
Molecular Properties
| Compound Name | 2-fluoroethyl 9-fluorodecanoate |
| PubChem CID | 3033283 |
| Molecular Formula | C12H22F2O2 |
| Molecular Weight | 236.30 g/mol |
| Exact Mass | 236.16 |
| IUPAC Name | 2-fluoroethyl 9-fluorodecanoate |
| SMILES | CC(F)CCCCCCCC(=O)OCCF |
| InChI | InChI=1S/C12H22F2O2/c1-11(14)7-5-3-2-4-6-8-12(15)16-10-9-13/h11H,2-10H2,1H3 |
| InChIKey | QBWJGVMACCYGNZ-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.30 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-fluoroethyl 9-fluorodecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoroethyl 9-fluorodecanoate?
The IUPAC name of 2-fluoroethyl 9-fluorodecanoate (CID 3033283) is 2-fluoroethyl 9-fluorodecanoate.
What is the SMILES notation for 2-fluoroethyl 9-fluorodecanoate?
The canonical SMILES for 2-fluoroethyl 9-fluorodecanoate is CC(F)CCCCCCCC(=O)OCCF.
What is the InChIKey of 2-fluoroethyl 9-fluorodecanoate?
The InChIKey is QBWJGVMACCYGNZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22F2O2/c1-11(14)7-5-3-2-4-6-8-12(15)16-10-9-13/h11H,2-10H2,1H3.
What are the key properties of 2-fluoroethyl 9-fluorodecanoate?
2-fluoroethyl 9-fluorodecanoate has a molecular weight of 236.30 g/mol, XLogP of 3.59, 10 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoroethyl 9-fluorodecanoate is sourced from PubChem (CID 3033283), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).