C22H31N5O3S — CID 30332851
2-[3-(4-methoxyphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]-N-[(1-morpholin-4-ylcyclohexyl)methyl]acetamide (PubChem CID 30332851) has the molecular formula C22H31N5O3S and a molecular weight of 445.59 g/mol. Its IUPAC name is 2-[3-(4-methoxyphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]-N-[(1-morpholin-4-ylcyclohexyl)methyl]acetamide.
| Compound Name | 2-[3-(4-methoxyphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]-N-[(1-morpholin-4-ylcyclohexyl)methyl]acetamide |
|---|---|
| PubChem CID | 30332851 |
| Molecular Formula | C22H31N5O3S |
| Molecular Weight | 445.59 g/mol |
| Exact Mass | 445.21 |
| IUPAC Name | 2-[3-(4-methoxyphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]-N-[(1-morpholin-4-ylcyclohexyl)methyl]acetamide |
| SMILES | COc1ccc(-c2n[nH]c(=S)n2CC(=O)NCC2(N3CCOCC3)CCCCC2)cc1 |
| InChI | InChI=1S/C22H31N5O3S/c1-29-18-7-5-17(6-8-18)20-24-25-21(31)27(20)15-19(28)23-16-22(9-3-2-4-10-22)26-11-13-30-14-12-26/h5-8H,2-4,9-16H2,1H3,(H,23,28)(H,25,31) |
| InChIKey | NBKAFRDFSJTNIE-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 84.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.59 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|