C13H18N2O2S — CID 3033347
5-cyclopent-2-en-1-yl-5-(2-methylpropyl)-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 3033347) has the molecular formula C13H18N2O2S and a molecular weight of 266.37 g/mol. Its IUPAC name is 5-cyclopent-2-en-1-yl-5-(2-methylpropyl)-2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | 5-cyclopent-2-en-1-yl-5-(2-methylpropyl)-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 3033347 |
| Molecular Formula | C13H18N2O2S |
| Molecular Weight | 266.37 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | 5-cyclopent-2-en-1-yl-5-(2-methylpropyl)-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | CC(C)CC1(C2C=CCC2)C(=O)NC(=S)NC1=O |
| InChI | InChI=1S/C13H18N2O2S/c1-8(2)7-13(9-5-3-4-6-9)10(16)14-12(18)15-11(13)17/h3,5,8-9H,4,6-7H2,1-2H3,(H2,14,15,16,17,18) |
| InChIKey | VZZNHZKGDVXKML-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.37 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|