C10H18N6S2 — CID 3033597
[[3-(carbamothioylhydrazinylidene)-2,2,4,4-tetramethylcyclobutylidene]amino]thiourea (PubChem CID 3033597) has the molecular formula C10H18N6S2 and a molecular weight of 286.43 g/mol. Its IUPAC name is [[3-(carbamothioylhydrazinylidene)-2,2,4,4-tetramethylcyclobutylidene]amino]thiourea.
| Compound Name | [[3-(carbamothioylhydrazinylidene)-2,2,4,4-tetramethylcyclobutylidene]amino]thiourea |
|---|---|
| PubChem CID | 3033597 |
| Molecular Formula | C10H18N6S2 |
| Molecular Weight | 286.43 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | [[3-(carbamothioylhydrazinylidene)-2,2,4,4-tetramethylcyclobutylidene]amino]thiourea |
| SMILES | CC1(C)C(=NNC(N)=S)C(C)(C)C1=NNC(N)=S |
| InChI | InChI=1S/C10H18N6S2/c1-9(2)5(13-15-7(11)17)10(3,4)6(9)14-16-8(12)18/h1-4H3,(H3,11,15,17)(H3,12,16,18)/b13-5-,14-6+ |
| InChIKey | KSUFJHSFYCATLI-FUJGBLOQSA-N |
| XLogP | 0.43 |
| TPSA | 100.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.43 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|