About 3a-methyl-5,6-dihydro-4H-2-benzofuran-1,3-dione
3a-methyl-5,6-dihydro-4H-2-benzofuran-1,3-dione (PubChem CID 3033842) has the molecular formula C9H10O3
and a molecular weight of 166.18 g/mol. Its IUPAC name is 3a-methyl-5,6-dihydro-4H-2-benzofuran-1,3-dione.
Molecular Properties
| Compound Name | 3a-methyl-5,6-dihydro-4H-2-benzofuran-1,3-dione |
| PubChem CID | 3033842 |
| Molecular Formula | C9H10O3 |
| Molecular Weight | 166.18 g/mol |
| Exact Mass | 166.06 |
| IUPAC Name | 3a-methyl-5,6-dihydro-4H-2-benzofuran-1,3-dione |
| SMILES | CC12CCCC=C1C(=O)OC2=O |
| InChI | InChI=1S/C9H10O3/c1-9-5-3-2-4-6(9)7(10)12-8(9)11/h4H,2-3,5H2,1H3 |
| InChIKey | LOYDTBZMMPQJNI-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.18 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 3a-methyl-5,6-dihydro-4H-2-benzofuran-1,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3a-methyl-5,6-dihydro-4H-2-benzofuran-1,3-dione?
The IUPAC name of 3a-methyl-5,6-dihydro-4H-2-benzofuran-1,3-dione (CID 3033842) is 3a-methyl-5,6-dihydro-4H-2-benzofuran-1,3-dione.
What is the SMILES notation for 3a-methyl-5,6-dihydro-4H-2-benzofuran-1,3-dione?
The canonical SMILES for 3a-methyl-5,6-dihydro-4H-2-benzofuran-1,3-dione is CC12CCCC=C1C(=O)OC2=O.
What is the InChIKey of 3a-methyl-5,6-dihydro-4H-2-benzofuran-1,3-dione?
The InChIKey is LOYDTBZMMPQJNI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O3/c1-9-5-3-2-4-6(9)7(10)12-8(9)11/h4H,2-3,5H2,1H3.
What are the key properties of 3a-methyl-5,6-dihydro-4H-2-benzofuran-1,3-dione?
3a-methyl-5,6-dihydro-4H-2-benzofuran-1,3-dione has a molecular weight of 166.18 g/mol, XLogP of 1.19, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3a-methyl-5,6-dihydro-4H-2-benzofuran-1,3-dione is sourced from PubChem (CID 3033842), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).