C12H16 — CID 3033878
4,5-dimethyltricyclo[5.2.1.02,6]deca-3,8-diene (PubChem CID 3033878) has the molecular formula C12H16 and a molecular weight of 160.26 g/mol. Its IUPAC name is 4,5-dimethyltricyclo[5.2.1.02,6]deca-3,8-diene.
| Compound Name | 4,5-dimethyltricyclo[5.2.1.02,6]deca-3,8-diene |
|---|---|
| PubChem CID | 3033878 |
| Molecular Formula | C12H16 |
| Molecular Weight | 160.26 g/mol |
| Exact Mass | 160.13 |
| IUPAC Name | 4,5-dimethyltricyclo[5.2.1.02,6]deca-3,8-diene |
| SMILES | CC1=CC2C3C=CC(C3)C2C1C |
| InChI | InChI=1S/C12H16/c1-7-5-11-9-3-4-10(6-9)12(11)8(7)2/h3-5,8-12H,6H2,1-2H3 |
| InChIKey | GUOAPVPPPVLIQQ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.26 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|