About 2-[4-[(Z)-1,2-diphenylbut-1-enyl]phenoxy]ethanol
2-[4-[(Z)-1,2-diphenylbut-1-enyl]phenoxy]ethanol (PubChem CID 3033897) has the molecular formula C24H24O2
and a molecular weight of 344.45 g/mol. Its IUPAC name is 2-[4-[(Z)-1,2-diphenylbut-1-enyl]phenoxy]ethanol.
Molecular Properties
| Compound Name | 2-[4-[(Z)-1,2-diphenylbut-1-enyl]phenoxy]ethanol |
| PubChem CID | 3033897 |
| Molecular Formula | C24H24O2 |
| Molecular Weight | 344.45 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | 2-[4-[(Z)-1,2-diphenylbut-1-enyl]phenoxy]ethanol |
| SMILES | CC/C(=C(\c1ccccc1)c1ccc(OCCO)cc1)c1ccccc1 |
| InChI | InChI=1S/C24H24O2/c1-2-23(19-9-5-3-6-10-19)24(20-11-7-4-8-12-20)21-13-15-22(16-14-21)26-18-17-25/h3-16,25H,2,17-18H2,1H3/b24-23- |
| InChIKey | TWASUFZMILCYJY-VHXPQNKSSA-N |
| XLogP | 5.43 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 344.45 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-[(Z)-1,2-diphenylbut-1-enyl]phenoxy]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[(Z)-1,2-diphenylbut-1-enyl]phenoxy]ethanol?
The IUPAC name of 2-[4-[(Z)-1,2-diphenylbut-1-enyl]phenoxy]ethanol (CID 3033897) is 2-[4-[(Z)-1,2-diphenylbut-1-enyl]phenoxy]ethanol.
What is the SMILES notation for 2-[4-[(Z)-1,2-diphenylbut-1-enyl]phenoxy]ethanol?
The canonical SMILES for 2-[4-[(Z)-1,2-diphenylbut-1-enyl]phenoxy]ethanol is CC/C(=C(\c1ccccc1)c1ccc(OCCO)cc1)c1ccccc1.
What is the InChIKey of 2-[4-[(Z)-1,2-diphenylbut-1-enyl]phenoxy]ethanol?
The InChIKey is TWASUFZMILCYJY-VHXPQNKSSA-N. The full InChI is InChI=1S/C24H24O2/c1-2-23(19-9-5-3-6-10-19)24(20-11-7-4-8-12-20)21-13-15-22(16-14-21)26-18-17-25/h3-16,25H,2,17-18H2,1H3/b24-23-.
What are the key properties of 2-[4-[(Z)-1,2-diphenylbut-1-enyl]phenoxy]ethanol?
2-[4-[(Z)-1,2-diphenylbut-1-enyl]phenoxy]ethanol has a molecular weight of 344.45 g/mol, XLogP of 5.43, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[(Z)-1,2-diphenylbut-1-enyl]phenoxy]ethanol is sourced from PubChem (CID 3033897), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).