C12H20N4O8P2S — CID 3033991
2-[3-[(4-amino-2-methylpyrimidin-5-yl)methyl]-4-methyl-1,3-thiazol-3-ium-5-yl]ethyl dihydrogen phosphate;dihydrogen phosphate (PubChem CID 3033991) has the molecular formula C12H20N4O8P2S and a molecular weight of 442.33 g/mol. Its IUPAC name is 2-[3-[(4-amino-2-methylpyrimidin-5-yl)methyl]-4-methyl-1,3-thiazol-3-ium-5-yl]ethyl dihydrogen phosphate;dihydrogen phosphate.
| Compound Name | 2-[3-[(4-amino-2-methylpyrimidin-5-yl)methyl]-4-methyl-1,3-thiazol-3-ium-5-yl]ethyl dihydrogen phosphate;dihydrogen phosphate |
|---|---|
| PubChem CID | 3033991 |
| Molecular Formula | C12H20N4O8P2S |
| Molecular Weight | 442.33 g/mol |
| Exact Mass | 442.05 |
| IUPAC Name | 2-[3-[(4-amino-2-methylpyrimidin-5-yl)methyl]-4-methyl-1,3-thiazol-3-ium-5-yl]ethyl dihydrogen phosphate;dihydrogen phosphate |
| SMILES | Cc1ncc(C[n+]2csc(CCOP(=O)(O)O)c2C)c(N)n1.O=P([O-])(O)O |
| InChI | InChI=1S/C12H17N4O4PS.H3O4P/c1-8-11(3-4-20-21(17,18)19)22-7-16(8)6-10-5-14-9(2)15-12(10)13;1-5(2,3)4/h5,7H,3-4,6H2,1-2H3,(H3-,13,14,15,17,18,19);(H3,1,2,3,4) |
| InChIKey | CUWOKLAYADTBBR-UHFFFAOYSA-N |
| XLogP | -0.84 |
| TPSA | 203.03 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.33 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|