About 4-(aminomethyl)benzenesulfonamide;(4-aminophenyl)sulfonylthiourea
4-(aminomethyl)benzenesulfonamide;(4-aminophenyl)sulfonylthiourea (PubChem CID 3034019) has the molecular formula C14H19N5O4S3
and a molecular weight of 417.54 g/mol. Its IUPAC name is 4-(aminomethyl)benzenesulfonamide;(4-aminophenyl)sulfonylthiourea.
Molecular Properties
| Compound Name | 4-(aminomethyl)benzenesulfonamide;(4-aminophenyl)sulfonylthiourea |
| PubChem CID | 3034019 |
| Molecular Formula | C14H19N5O4S3 |
| Molecular Weight | 417.54 g/mol |
| Exact Mass | 417.06 |
| IUPAC Name | 4-(aminomethyl)benzenesulfonamide;(4-aminophenyl)sulfonylthiourea |
| SMILES | NC(=S)NS(=O)(=O)c1ccc(N)cc1.NCc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C7H9N3O2S2.C7H10N2O2S/c8-5-1-3-6(4-2-5)14(11,12)10-7(9)13;8-5-6-1-3-7(4-2-6)12(9,10)11/h1-4H,8H2,(H3,9,10,13);1-4H,5,8H2,(H2,9,10,11) |
| InChIKey | ZLYHTQKHXIVMLY-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 184.39 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 417.54 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 4-(aminomethyl)benzenesulfonamide;(4-aminophenyl)sulfonylthiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(aminomethyl)benzenesulfonamide;(4-aminophenyl)sulfonylthiourea?
The IUPAC name of 4-(aminomethyl)benzenesulfonamide;(4-aminophenyl)sulfonylthiourea (CID 3034019) is 4-(aminomethyl)benzenesulfonamide;(4-aminophenyl)sulfonylthiourea.
What is the SMILES notation for 4-(aminomethyl)benzenesulfonamide;(4-aminophenyl)sulfonylthiourea?
The canonical SMILES for 4-(aminomethyl)benzenesulfonamide;(4-aminophenyl)sulfonylthiourea is NC(=S)NS(=O)(=O)c1ccc(N)cc1.NCc1ccc(S(N)(=O)=O)cc1.
What is the InChIKey of 4-(aminomethyl)benzenesulfonamide;(4-aminophenyl)sulfonylthiourea?
The InChIKey is ZLYHTQKHXIVMLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N3O2S2.C7H10N2O2S/c8-5-1-3-6(4-2-5)14(11,12)10-7(9)13;8-5-6-1-3-7(4-2-6)12(9,10)11/h1-4H,8H2,(H3,9,10,13);1-4H,5,8H2,(H2,9,10,11).
What are the key properties of 4-(aminomethyl)benzenesulfonamide;(4-aminophenyl)sulfonylthiourea?
4-(aminomethyl)benzenesulfonamide;(4-aminophenyl)sulfonylthiourea has a molecular weight of 417.54 g/mol, XLogP of -0.42, 4 rotatable bonds, 5 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(aminomethyl)benzenesulfonamide;(4-aminophenyl)sulfonylthiourea is sourced from PubChem (CID 3034019), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).