About 3H-1,3-benzothiazole-2-thione;1-(diaminomethylidene)-2-phenylguanidine
3H-1,3-benzothiazole-2-thione;1-(diaminomethylidene)-2-phenylguanidine (PubChem CID 3034162) has the molecular formula C15H16N6S2
and a molecular weight of 344.47 g/mol. Its IUPAC name is 3H-1,3-benzothiazole-2-thione;1-(diaminomethylidene)-2-phenylguanidine.
Molecular Properties
| Compound Name | 3H-1,3-benzothiazole-2-thione;1-(diaminomethylidene)-2-phenylguanidine |
| PubChem CID | 3034162 |
| Molecular Formula | C15H16N6S2 |
| Molecular Weight | 344.47 g/mol |
| Exact Mass | 344.09 |
| IUPAC Name | 3H-1,3-benzothiazole-2-thione;1-(diaminomethylidene)-2-phenylguanidine |
| SMILES | NC(N)=N/C(N)=N/c1ccccc1.S=c1[nH]c2ccccc2s1 |
| InChI | InChI=1S/C8H11N5.C7H5NS2/c9-7(10)13-8(11)12-6-4-2-1-3-5-6;9-7-8-5-3-1-2-4-6(5)10-7/h1-5H,(H6,9,10,11,12,13);1-4H,(H,8,9) |
| InChIKey | HQXQVKSGCXSRGH-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 118.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.47 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3H-1,3-benzothiazole-2-thione;1-(diaminomethylidene)-2-phenylguanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3H-1,3-benzothiazole-2-thione;1-(diaminomethylidene)-2-phenylguanidine?
The IUPAC name of 3H-1,3-benzothiazole-2-thione;1-(diaminomethylidene)-2-phenylguanidine (CID 3034162) is 3H-1,3-benzothiazole-2-thione;1-(diaminomethylidene)-2-phenylguanidine.
What is the SMILES notation for 3H-1,3-benzothiazole-2-thione;1-(diaminomethylidene)-2-phenylguanidine?
The canonical SMILES for 3H-1,3-benzothiazole-2-thione;1-(diaminomethylidene)-2-phenylguanidine is NC(N)=N/C(N)=N/c1ccccc1.S=c1[nH]c2ccccc2s1.
What is the InChIKey of 3H-1,3-benzothiazole-2-thione;1-(diaminomethylidene)-2-phenylguanidine?
The InChIKey is HQXQVKSGCXSRGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N5.C7H5NS2/c9-7(10)13-8(11)12-6-4-2-1-3-5-6;9-7-8-5-3-1-2-4-6(5)10-7/h1-5H,(H6,9,10,11,12,13);1-4H,(H,8,9).
What are the key properties of 3H-1,3-benzothiazole-2-thione;1-(diaminomethylidene)-2-phenylguanidine?
3H-1,3-benzothiazole-2-thione;1-(diaminomethylidene)-2-phenylguanidine has a molecular weight of 344.47 g/mol, XLogP of 2.87, 1 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3H-1,3-benzothiazole-2-thione;1-(diaminomethylidene)-2-phenylguanidine is sourced from PubChem (CID 3034162), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).