About 1-butyl-3-phenylthiourea
1-butyl-3-phenylthiourea (PubChem CID 3034183) has the molecular formula C11H16N2S
and a molecular weight of 208.33 g/mol. Its IUPAC name is 1-butyl-3-phenylthiourea.
Molecular Properties
| Compound Name | 1-butyl-3-phenylthiourea |
| PubChem CID | 3034183 |
| Molecular Formula | C11H16N2S |
| Molecular Weight | 208.33 g/mol |
| Exact Mass | 208.10 |
| IUPAC Name | 1-butyl-3-phenylthiourea |
| SMILES | CCCCNC(=S)Nc1ccccc1 |
| InChI | InChI=1S/C11H16N2S/c1-2-3-9-12-11(14)13-10-7-5-4-6-8-10/h4-8H,2-3,9H2,1H3,(H2,12,13,14) |
| InChIKey | MXLMUGKRDLWVJZ-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.33 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-butyl-3-phenylthiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butyl-3-phenylthiourea?
The IUPAC name of 1-butyl-3-phenylthiourea (CID 3034183) is 1-butyl-3-phenylthiourea.
What is the SMILES notation for 1-butyl-3-phenylthiourea?
The canonical SMILES for 1-butyl-3-phenylthiourea is CCCCNC(=S)Nc1ccccc1.
What is the InChIKey of 1-butyl-3-phenylthiourea?
The InChIKey is MXLMUGKRDLWVJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N2S/c1-2-3-9-12-11(14)13-10-7-5-4-6-8-10/h4-8H,2-3,9H2,1H3,(H2,12,13,14).
What are the key properties of 1-butyl-3-phenylthiourea?
1-butyl-3-phenylthiourea has a molecular weight of 208.33 g/mol, XLogP of 2.77, 4 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butyl-3-phenylthiourea is sourced from PubChem (CID 3034183), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).