About 4-azidobenzoic acid
4-azidobenzoic acid (PubChem CID 3034184) has the molecular formula C7H5N3O2
and a molecular weight of 163.14 g/mol. Its IUPAC name is 4-azidobenzoic acid.
Molecular Properties
| Compound Name | 4-azidobenzoic acid |
| PubChem CID | 3034184 |
| Molecular Formula | C7H5N3O2 |
| Molecular Weight | 163.14 g/mol |
| Exact Mass | 163.04 |
| IUPAC Name | 4-azidobenzoic acid |
| SMILES | [N-]=[N+]=Nc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C7H5N3O2/c8-10-9-6-3-1-5(2-4-6)7(11)12/h1-4H,(H,11,12) |
| InChIKey | PQXPAFTXDVNANI-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 86.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.14 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 4-azidobenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-azidobenzoic acid?
The IUPAC name of 4-azidobenzoic acid (CID 3034184) is 4-azidobenzoic acid.
What is the SMILES notation for 4-azidobenzoic acid?
The canonical SMILES for 4-azidobenzoic acid is [N-]=[N+]=Nc1ccc(C(=O)O)cc1.
What is the InChIKey of 4-azidobenzoic acid?
The InChIKey is PQXPAFTXDVNANI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5N3O2/c8-10-9-6-3-1-5(2-4-6)7(11)12/h1-4H,(H,11,12).
What are the key properties of 4-azidobenzoic acid?
4-azidobenzoic acid has a molecular weight of 163.14 g/mol, XLogP of 2.33, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-azidobenzoic acid is sourced from PubChem (CID 3034184), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).