About 3-methylbutanethioamide
3-methylbutanethioamide (PubChem CID 3034257) has the molecular formula C5H11NS
and a molecular weight of 117.22 g/mol. Its IUPAC name is 3-methylbutanethioamide.
Molecular Properties
| Compound Name | 3-methylbutanethioamide |
| PubChem CID | 3034257 |
| Molecular Formula | C5H11NS |
| Molecular Weight | 117.22 g/mol |
| Exact Mass | 117.06 |
| IUPAC Name | 3-methylbutanethioamide |
| SMILES | CC(C)CC(N)=S |
| InChI | InChI=1S/C5H11NS/c1-4(2)3-5(6)7/h4H,3H2,1-2H3,(H2,6,7) |
| InChIKey | NFWCTMFZCLAVSD-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 117.22 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3-methylbutanethioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylbutanethioamide?
The IUPAC name of 3-methylbutanethioamide (CID 3034257) is 3-methylbutanethioamide.
What is the SMILES notation for 3-methylbutanethioamide?
The canonical SMILES for 3-methylbutanethioamide is CC(C)CC(N)=S.
What is the InChIKey of 3-methylbutanethioamide?
The InChIKey is NFWCTMFZCLAVSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11NS/c1-4(2)3-5(6)7/h4H,3H2,1-2H3,(H2,6,7).
What are the key properties of 3-methylbutanethioamide?
3-methylbutanethioamide has a molecular weight of 117.22 g/mol, XLogP of 1.32, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylbutanethioamide is sourced from PubChem (CID 3034257), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).