About N-(4-bromo-9,10-dioxoanthracen-1-yl)-2-cyano-N-methylacetamide
N-(4-bromo-9,10-dioxoanthracen-1-yl)-2-cyano-N-methylacetamide (PubChem CID 3034286) has the molecular formula C18H11BrN2O3
and a molecular weight of 383.20 g/mol. Its IUPAC name is N-(4-bromo-9,10-dioxoanthracen-1-yl)-2-cyano-N-methylacetamide.
Molecular Properties
| Compound Name | N-(4-bromo-9,10-dioxoanthracen-1-yl)-2-cyano-N-methylacetamide |
| PubChem CID | 3034286 |
| Molecular Formula | C18H11BrN2O3 |
| Molecular Weight | 383.20 g/mol |
| Exact Mass | 382.00 |
| IUPAC Name | N-(4-bromo-9,10-dioxoanthracen-1-yl)-2-cyano-N-methylacetamide |
| SMILES | CN(C(=O)CC#N)c1ccc(Br)c2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C18H11BrN2O3/c1-21(14(22)8-9-20)13-7-6-12(19)15-16(13)18(24)11-5-3-2-4-10(11)17(15)23/h2-7H,8H2,1H3 |
| InChIKey | IXMSAEUVILDDHT-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 78.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 383.20 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|
Analyze N-(4-bromo-9,10-dioxoanthracen-1-yl)-2-cyano-N-methylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-bromo-9,10-dioxoanthracen-1-yl)-2-cyano-N-methylacetamide?
The IUPAC name of N-(4-bromo-9,10-dioxoanthracen-1-yl)-2-cyano-N-methylacetamide (CID 3034286) is N-(4-bromo-9,10-dioxoanthracen-1-yl)-2-cyano-N-methylacetamide.
What is the SMILES notation for N-(4-bromo-9,10-dioxoanthracen-1-yl)-2-cyano-N-methylacetamide?
The canonical SMILES for N-(4-bromo-9,10-dioxoanthracen-1-yl)-2-cyano-N-methylacetamide is CN(C(=O)CC#N)c1ccc(Br)c2c1C(=O)c1ccccc1C2=O.
What is the InChIKey of N-(4-bromo-9,10-dioxoanthracen-1-yl)-2-cyano-N-methylacetamide?
The InChIKey is IXMSAEUVILDDHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H11BrN2O3/c1-21(14(22)8-9-20)13-7-6-12(19)15-16(13)18(24)11-5-3-2-4-10(11)17(15)23/h2-7H,8H2,1H3.
What are the key properties of N-(4-bromo-9,10-dioxoanthracen-1-yl)-2-cyano-N-methylacetamide?
N-(4-bromo-9,10-dioxoanthracen-1-yl)-2-cyano-N-methylacetamide has a molecular weight of 383.20 g/mol, XLogP of 3.10, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-bromo-9,10-dioxoanthracen-1-yl)-2-cyano-N-methylacetamide is sourced from PubChem (CID 3034286), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).