C12H13N3O3S4 — CID 3034354
3-[[(5Z)-4-methyl-5-(4-oxo-3-prop-2-enyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)-1,3,4-thiadiazol-2-yl]sulfanyl]propanoic acid (PubChem CID 3034354) has the molecular formula C12H13N3O3S4 and a molecular weight of 375.52 g/mol. Its IUPAC name is 3-[[(5Z)-4-methyl-5-(4-oxo-3-prop-2-enyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)-1,3,4-thiadiazol-2-yl]sulfanyl]propanoic acid.
| Compound Name | 3-[[(5Z)-4-methyl-5-(4-oxo-3-prop-2-enyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)-1,3,4-thiadiazol-2-yl]sulfanyl]propanoic acid |
|---|---|
| PubChem CID | 3034354 |
| Molecular Formula | C12H13N3O3S4 |
| Molecular Weight | 375.52 g/mol |
| Exact Mass | 374.98 |
| IUPAC Name | 3-[[(5Z)-4-methyl-5-(4-oxo-3-prop-2-enyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)-1,3,4-thiadiazol-2-yl]sulfanyl]propanoic acid |
| SMILES | C=CCN1C(=O)/C(=C2/SC(SCCC(=O)O)=NN2C)SC1=S |
| InChI | InChI=1S/C12H13N3O3S4/c1-3-5-15-9(18)8(21-12(15)19)10-14(2)13-11(22-10)20-6-4-7(16)17/h3H,1,4-6H2,2H3,(H,16,17)/b10-8- |
| InChIKey | BWPACKUSUFELQM-NTMALXAHSA-N |
| XLogP | 2.36 |
| TPSA | 73.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.52 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|