About 3-butyl-4,6,6-trimethyl-1H-pyrimidine-2-thione
3-butyl-4,6,6-trimethyl-1H-pyrimidine-2-thione (PubChem CID 3034503) has the molecular formula C11H20N2S
and a molecular weight of 212.36 g/mol. Its IUPAC name is 3-butyl-4,6,6-trimethyl-1H-pyrimidine-2-thione.
Molecular Properties
| Compound Name | 3-butyl-4,6,6-trimethyl-1H-pyrimidine-2-thione |
| PubChem CID | 3034503 |
| Molecular Formula | C11H20N2S |
| Molecular Weight | 212.36 g/mol |
| Exact Mass | 212.13 |
| IUPAC Name | 3-butyl-4,6,6-trimethyl-1H-pyrimidine-2-thione |
| SMILES | CCCCN1C(=S)NC(C)(C)C=C1C |
| InChI | InChI=1S/C11H20N2S/c1-5-6-7-13-9(2)8-11(3,4)12-10(13)14/h8H,5-7H2,1-4H3,(H,12,14) |
| InChIKey | AUGPKHYVZOGKLQ-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.36 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3-butyl-4,6,6-trimethyl-1H-pyrimidine-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-butyl-4,6,6-trimethyl-1H-pyrimidine-2-thione?
The IUPAC name of 3-butyl-4,6,6-trimethyl-1H-pyrimidine-2-thione (CID 3034503) is 3-butyl-4,6,6-trimethyl-1H-pyrimidine-2-thione.
What is the SMILES notation for 3-butyl-4,6,6-trimethyl-1H-pyrimidine-2-thione?
The canonical SMILES for 3-butyl-4,6,6-trimethyl-1H-pyrimidine-2-thione is CCCCN1C(=S)NC(C)(C)C=C1C.
What is the InChIKey of 3-butyl-4,6,6-trimethyl-1H-pyrimidine-2-thione?
The InChIKey is AUGPKHYVZOGKLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20N2S/c1-5-6-7-13-9(2)8-11(3,4)12-10(13)14/h8H,5-7H2,1-4H3,(H,12,14).
What are the key properties of 3-butyl-4,6,6-trimethyl-1H-pyrimidine-2-thione?
3-butyl-4,6,6-trimethyl-1H-pyrimidine-2-thione has a molecular weight of 212.36 g/mol, XLogP of 2.66, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-butyl-4,6,6-trimethyl-1H-pyrimidine-2-thione is sourced from PubChem (CID 3034503), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).